summaryrefslogtreecommitdiffstats
path: root/tools/syslogd.c
diff options
context:
space:
mode:
Diffstat (limited to 'tools/syslogd.c')
-rw-r--r--tools/syslogd.c3543
1 files changed, 3543 insertions, 0 deletions
diff --git a/tools/syslogd.c b/tools/syslogd.c
new file mode 100644
index 00000000..6f32b262
--- /dev/null
+++ b/tools/syslogd.c
@@ -0,0 +1,3543 @@
+/**
+ * \brief This is the main file of the rsyslogd daemon.
+ *
+ * Please visit the rsyslog project at
+ *
+ * http://www.rsyslog.com
+ *
+ * to learn more about it and discuss any questions you may have.
+ *
+ * rsyslog had initially been forked from the sysklogd project.
+ * I would like to express my thanks to the developers of the sysklogd
+ * package - without it, I would have had a much harder start...
+ *
+ * Please note that while rsyslog started from the sysklogd code base,
+ * it nowadays has almost nothing left in common with it. Allmost all
+ * parts of the code have been rewritten.
+ *
+ * This Project was intiated and is maintained by
+ * Rainer Gerhards <rgerhards@hq.adiscon.com>. See
+ * AUTHORS to learn who helped make it become a reality.
+ *
+ * If you have questions about rsyslogd in general, please email
+ * info@adiscon.com. To learn more about rsyslogd, please visit
+ * http://www.rsyslog.com.
+ *
+ * \author Rainer Gerhards <rgerhards@adiscon.com>
+ * \date 2003-10-17
+ * Some initial modifications on the sysklogd package to support
+ * liblogging. These have actually not yet been merged to the
+ * source you see currently (but they hopefully will)
+ *
+ * \date 2004-10-28
+ * Restarted the modifications of sysklogd. This time, we
+ * focus on a simpler approach first. The initial goal is to
+ * provide MySQL database support (so that syslogd can log
+ * to the database).
+ *
+ * rsyslog - An Enhanced syslogd Replacement.
+ * Copyright 2003-2008 Rainer Gerhards and Adiscon GmbH.
+ *
+ * This file is part of rsyslog.
+ *
+ * Rsyslog is free software: you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation, either version 3 of the License, or
+ * (at your option) any later version.
+ *
+ * Rsyslog is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with Rsyslog. If not, see <http://www.gnu.org/licenses/>.
+ *
+ * A copy of the GPL can be found in the file "COPYING" in this distribution.
+ */
+#include "config.h"
+#include "rsyslog.h"
+
+#define DEFUPRI (LOG_USER|LOG_NOTICE)
+#define TIMERINTVL 30 /* interval for checking flush, mark */
+
+#include <unistd.h>
+#include <stdlib.h>
+#include <stdio.h>
+#include <stddef.h>
+#include <ctype.h>
+#include <limits.h>
+#define GNU_SOURCE
+#include <string.h>
+#include <stdarg.h>
+#include <time.h>
+#include <assert.h>
+#include <libgen.h>
+
+#ifdef __sun
+# include <errno.h>
+#else
+# include <sys/errno.h>
+#endif
+#include <sys/ioctl.h>
+#include <sys/wait.h>
+#include <sys/file.h>
+
+#if HAVE_SYS_TIMESPEC_H
+# include <sys/timespec.h>
+#endif
+
+#if HAVE_SYS_STAT_H
+# include <sys/stat.h>
+#endif
+
+#include <signal.h>
+
+#if HAVE_PATHS_H
+#include <paths.h>
+#endif
+
+#ifdef USE_NETZIP
+#include <zlib.h>
+#endif
+
+#include <netdb.h>
+
+#include "pidfile.h"
+#include "srUtils.h"
+#include "stringbuf.h"
+#include "syslogd-types.h"
+#include "template.h"
+#include "outchannel.h"
+#include "syslogd.h"
+
+#include "msg.h"
+#include "modules.h"
+#include "action.h"
+#include "iminternal.h"
+#include "cfsysline.h"
+#include "omshell.h"
+#include "omusrmsg.h"
+#include "omfwd.h"
+#include "omfile.h"
+#include "omdiscard.h"
+#include "threads.h"
+#include "queue.h"
+#include "stream.h"
+#include "conf.h"
+#include "vm.h"
+#include "errmsg.h"
+#include "datetime.h"
+#include "sysvar.h"
+
+/* definitions for objects we access */
+DEFobjCurrIf(obj)
+DEFobjCurrIf(glbl)
+DEFobjCurrIf(datetime)
+DEFobjCurrIf(conf)
+DEFobjCurrIf(expr)
+DEFobjCurrIf(vm)
+DEFobjCurrIf(var)
+DEFobjCurrIf(module)
+DEFobjCurrIf(errmsg)
+DEFobjCurrIf(net) /* TODO: make go away! */
+
+
+/* forward definitions */
+static rsRetVal GlobalClassExit(void);
+
+/* We define our own set of syslog defintions so that we
+ * do not need to rely on (possibly different) implementations.
+ * 2007-07-19 rgerhards
+ */
+/* missing definitions for solaris
+ * 2006-02-16 Rger
+ */
+#ifdef __sun
+# define LOG_AUTHPRIV LOG_AUTH
+#endif
+#define INTERNAL_NOPRI 0x10 /* the "no priority" priority */
+#define LOG_FTP (11<<3) /* ftp daemon */
+
+
+#ifndef UTMP_FILE
+#ifdef UTMP_FILENAME
+#define UTMP_FILE UTMP_FILENAME
+#else
+#ifdef _PATH_UTMP
+#define UTMP_FILE _PATH_UTMP
+#else
+#define UTMP_FILE "/etc/utmp"
+#endif
+#endif
+#endif
+
+#ifndef _PATH_LOGCONF
+#define _PATH_LOGCONF "/etc/rsyslog.conf"
+#endif
+
+#ifndef _PATH_MODDIR
+#define _PATH_MODDIR "/lib/rsyslog/"
+#endif
+
+#if defined(SYSLOGD_PIDNAME)
+# undef _PATH_LOGPID
+# if defined(FSSTND)
+# ifdef OS_BSD
+# define _PATH_VARRUN "/var/run/"
+# endif
+# if defined(__sun) || defined(__hpux)
+# define _PATH_VARRUN "/var/run/"
+# endif
+# define _PATH_LOGPID _PATH_VARRUN SYSLOGD_PIDNAME
+# else
+# define _PATH_LOGPID "/etc/" SYSLOGD_PIDNAME
+# endif
+#else
+# ifndef _PATH_LOGPID
+# if defined(__sun) || defined(__hpux)
+# define _PATH_VARRUN "/var/run/"
+# endif
+# if defined(FSSTND)
+# define _PATH_LOGPID _PATH_VARRUN "rsyslogd.pid"
+# else
+# define _PATH_LOGPID "/etc/rsyslogd.pid"
+# endif
+# endif
+#endif
+
+#ifndef _PATH_DEV
+# define _PATH_DEV "/dev/"
+#endif
+
+#ifndef _PATH_TTY
+#define _PATH_TTY "/dev/tty"
+#endif
+
+static uchar *ConfFile = (uchar*) _PATH_LOGCONF; /* read-only after startup */
+static char *PidFile = _PATH_LOGPID; /* read-only after startup */
+
+static pid_t myPid; /* our pid for use in self-generated messages, e.g. on startup */
+/* mypid is read-only after the initial fork() */
+static int restart = 0; /* do restart (config read) - multithread safe */
+
+static int bParseHOSTNAMEandTAG = 1; /* global config var: should the hostname and tag be
+ * parsed inside message - rgerhards, 2006-03-13 */
+static int bFinished = 0; /* used by termination signal handler, read-only except there
+ * is either 0 or the number of the signal that requested the
+ * termination.
+ */
+static int iConfigVerify = 0; /* is this just a config verify run? */
+
+/* Intervals at which we flush out "message repeated" messages,
+ * in seconds after previous message is logged. After each flush,
+ * we move to the next interval until we reach the largest.
+ * TODO: this shall go into action object! -- rgerhards, 2008-01-29
+ */
+int repeatinterval[2] = { 30, 60 }; /* # of secs before flush */
+
+#define LIST_DELIMITER ':' /* delimiter between two hosts */
+
+struct filed *Files = NULL; /* read-only after init() (but beware of sigusr1!) */
+
+static pid_t ppid; /* This is a quick and dirty hack used for spliting main/startup thread */
+
+typedef struct legacyOptsLL_s {
+ uchar *line;
+ struct legacyOptsLL_s *next;
+} legacyOptsLL_t;
+legacyOptsLL_t *pLegacyOptsLL = NULL;
+
+/* global variables for config file state */
+static int bDropTrailingLF = 1; /* drop trailing LF's on reception? */
+int iCompatibilityMode = 0; /* version we should be compatible with; 0 means sysklogd. It is
+ the default, so if no -c<n> option is given, we make ourselvs
+ as compatible to sysklogd as possible. */
+static int bDebugPrintTemplateList = 1;/* output template list in debug mode? */
+static int bDebugPrintCfSysLineHandlerList = 1;/* output cfsyslinehandler list in debug mode? */
+static int bDebugPrintModuleList = 1;/* output module list in debug mode? */
+static uchar cCCEscapeChar = '\\';/* character to be used to start an escape sequence for control chars */
+static int bEscapeCCOnRcv = 1; /* escape control characters on reception: 0 - no, 1 - yes */
+static int bErrMsgToStderr = 1; /* print error messages to stderr (in addition to everything else)? */
+int bReduceRepeatMsgs; /* reduce repeated message - 0 - no, 1 - yes */
+int bActExecWhenPrevSusp; /* execute action only when previous one was suspended? */
+int iActExecOnceInterval = 0; /* execute action once every nn seconds */
+/* end global config file state variables */
+
+int MarkInterval = 20 * 60; /* interval between marks in seconds - read-only after startup */
+int send_to_all = 0; /* send message to all IPv4/IPv6 addresses */
+static int NoFork = 0; /* don't fork - don't run in daemon mode - read-only after startup */
+static int bHaveMainQueue = 0;/* set to 1 if the main queue - in queueing mode - is available
+ * If the main queue is either not yet ready or not running in
+ * queueing mode (mode DIRECT!), then this is set to 0.
+ */
+
+extern int errno;
+
+/* main message queue and its configuration parameters */
+static queue_t *pMsgQueue = NULL; /* the main message queue */
+static int iMainMsgQueueSize = 10000; /* size of the main message queue above */
+static int iMainMsgQHighWtrMark = 8000; /* high water mark for disk-assisted queues */
+static int iMainMsgQLowWtrMark = 2000; /* low water mark for disk-assisted queues */
+static int iMainMsgQDiscardMark = 9800; /* begin to discard messages */
+static int iMainMsgQDiscardSeverity = 8; /* by default, discard nothing to prevent unintentional loss */
+static int iMainMsgQueueNumWorkers = 1; /* number of worker threads for the mm queue above */
+static queueType_t MainMsgQueType = QUEUETYPE_FIXED_ARRAY; /* type of the main message queue above */
+static uchar *pszMainMsgQFName = NULL; /* prefix for the main message queue file */
+static int64 iMainMsgQueMaxFileSize = 1024*1024;
+static int iMainMsgQPersistUpdCnt = 0; /* persist queue info every n updates */
+static int iMainMsgQtoQShutdown = 0; /* queue shutdown */
+static int iMainMsgQtoActShutdown = 1000; /* action shutdown (in phase 2) */
+static int iMainMsgQtoEnq = 2000; /* timeout for queue enque */
+static int iMainMsgQtoWrkShutdown = 60000; /* timeout for worker thread shutdown */
+static int iMainMsgQWrkMinMsgs = 100; /* minimum messages per worker needed to start a new one */
+static int iMainMsgQDeqSlowdown = 0; /* dequeue slowdown (simple rate limiting) */
+static int64 iMainMsgQueMaxDiskSpace = 0; /* max disk space allocated 0 ==> unlimited */
+static int bMainMsgQSaveOnShutdown = 1; /* save queue on shutdown (when DA enabled)? */
+static int iMainMsgQueueDeqtWinFromHr = 0; /* hour begin of time frame when queue is to be dequeued */
+static int iMainMsgQueueDeqtWinToHr = 25; /* hour begin of time frame when queue is to be dequeued */
+
+
+/* support for simple textual representation of FIOP names
+ * rgerhards, 2005-09-27
+ */
+static char* getFIOPName(unsigned iFIOP)
+{
+ char *pRet;
+ switch(iFIOP) {
+ case FIOP_CONTAINS:
+ pRet = "contains";
+ break;
+ case FIOP_ISEQUAL:
+ pRet = "isequal";
+ break;
+ case FIOP_STARTSWITH:
+ pRet = "startswith";
+ break;
+ case FIOP_REGEX:
+ pRet = "regex";
+ break;
+ default:
+ pRet = "NOP";
+ break;
+ }
+ return pRet;
+}
+
+
+/* Reset config variables to default values.
+ * rgerhards, 2007-07-17
+ */
+static rsRetVal resetConfigVariables(uchar __attribute__((unused)) *pp, void __attribute__((unused)) *pVal)
+{
+ cCCEscapeChar = '#';
+ bActExecWhenPrevSusp = 0;
+ iActExecOnceInterval = 0;
+ bDebugPrintTemplateList = 1;
+ bDebugPrintCfSysLineHandlerList = 1;
+ bDebugPrintModuleList = 1;
+ bEscapeCCOnRcv = 1; /* default is to escape control characters */
+ bReduceRepeatMsgs = 0;
+ if(pszMainMsgQFName != NULL) {
+ free(pszMainMsgQFName);
+ pszMainMsgQFName = NULL;
+ }
+ iMainMsgQueueSize = 10000;
+ iMainMsgQHighWtrMark = 8000;
+ iMainMsgQLowWtrMark = 2000;
+ iMainMsgQDiscardMark = 9800;
+ iMainMsgQDiscardSeverity = 8;
+ iMainMsgQueMaxFileSize = 1024 * 1024;
+ iMainMsgQueueNumWorkers = 1;
+ iMainMsgQPersistUpdCnt = 0;
+ iMainMsgQtoQShutdown = 0;
+ iMainMsgQtoActShutdown = 1000;
+ iMainMsgQtoEnq = 2000;
+ iMainMsgQtoWrkShutdown = 60000;
+ iMainMsgQWrkMinMsgs = 100;
+ iMainMsgQDeqSlowdown = 0;
+ bMainMsgQSaveOnShutdown = 1;
+ MainMsgQueType = QUEUETYPE_FIXED_ARRAY;
+ iMainMsgQueMaxDiskSpace = 0;
+ glbliActionResumeRetryCount = 0;
+
+ return RS_RET_OK;
+}
+
+
+/* hardcoded standard templates (used for defaults) */
+static uchar template_DebugFormat[] = "\"Debug line with all properties:\nFROMHOST: '%FROMHOST%', fromhost-ip: '%fromhost-ip%', HOSTNAME: '%HOSTNAME%', PRI: %PRI%,\nsyslogtag '%syslogtag%', programname: '%programname%', APP-NAME: '%APP-NAME%', PROCID: '%PROCID%', MSGID: '%MSGID%',\nTIMESTAMP: '%TIMESTAMP%', STRUCTURED-DATA: '%STRUCTURED-DATA%',\nmsg: '%msg%'\nescaped msg: '%msg:::drop-cc%'\nrawmsg: '%rawmsg%'\n\n\"";
+static uchar template_SyslogProtocol23Format[] = "\"<%PRI%>1 %TIMESTAMP:::date-rfc3339% %HOSTNAME% %APP-NAME% %PROCID% %MSGID% %STRUCTURED-DATA% %msg%\n\"";
+static uchar template_TraditionalFileFormat[] = "\"%TIMESTAMP% %HOSTNAME% %syslogtag%%msg:::sp-if-no-1st-sp%%msg:::drop-last-lf%\n\"";
+static uchar template_FileFormat[] = "\"%TIMESTAMP:::date-rfc3339% %HOSTNAME% %syslogtag%%msg:::sp-if-no-1st-sp%%msg:::drop-last-lf%\n\"";
+static uchar template_WallFmt[] = "\"\r\n\7Message from syslogd@%HOSTNAME% at %timegenerated% ...\r\n %syslogtag%%msg%\n\r\"";
+static uchar template_ForwardFormat[] = "\"<%PRI%>%TIMESTAMP:::date-rfc3339% %HOSTNAME% %syslogtag:1:32%%msg:::sp-if-no-1st-sp%%msg%\"";
+static uchar template_TraditionalForwardFormat[] = "\"<%PRI%>%TIMESTAMP% %HOSTNAME% %syslogtag:1:32%%msg:::sp-if-no-1st-sp%%msg%\"";
+static uchar template_StdUsrMsgFmt[] = "\" %syslogtag%%msg%\n\r\"";
+static uchar template_StdDBFmt[] = "\"insert into SystemEvents (Message, Facility, FromHost, Priority, DeviceReportedTime, ReceivedAt, InfoUnitID, SysLogTag) values ('%msg%', %syslogfacility%, '%HOSTNAME%', %syslogpriority%, '%timereported:::date-mysql%', '%timegenerated:::date-mysql%', %iut%, '%syslogtag%')\",SQL";
+static uchar template_StdPgSQLFmt[] = "\"insert into SystemEvents (Message, Facility, FromHost, Priority, DeviceReportedTime, ReceivedAt, InfoUnitID, SysLogTag) values ('%msg%', %syslogfacility%, '%HOSTNAME%', %syslogpriority%, '%timereported:::date-pgsql%', '%timegenerated:::date-pgsql%', %iut%, '%syslogtag%')\",STDSQL";
+/* end template */
+
+
+/* up to the next comment, prototypes that should be removed by reordering */
+/* Function prototypes. */
+static char **crunch_list(char *list);
+static void reapchild();
+static void debug_switch();
+static void sighup_handler();
+static void freeSelectors(void);
+static void processImInternal(void);
+
+
+static int usage(void)
+{
+ fprintf(stderr, "usage: rsyslogd [-c<version>] [-46AdnqQvwx] [-l<hostlist>] [-s<domainlist>]\n"
+ " [-f<conffile>] [-i<pidfile>] [-N<level>] [-M<module load path>]\n"
+ " [-u<number>]\n"
+ "To run rsyslogd in native mode, use \"rsyslogd -c3 <other options>\"\n\n"
+ "For further information see http://www.rsyslog.com/doc\n");
+ exit(1); /* "good" exit - done to terminate usage() */
+}
+
+
+/* function to destruct a selector_t object
+ * rgerhards, 2007-08-01
+ */
+rsRetVal
+selectorDestruct(void *pVal)
+{
+ selector_t *pThis = (selector_t *) pVal;
+
+ assert(pThis != NULL);
+
+ if(pThis->pCSHostnameComp != NULL)
+ rsCStrDestruct(&pThis->pCSHostnameComp);
+ if(pThis->pCSProgNameComp != NULL)
+ rsCStrDestruct(&pThis->pCSProgNameComp);
+
+ if(pThis->f_filter_type == FILTER_PROP) {
+ if(pThis->f_filterData.prop.pCSPropName != NULL)
+ rsCStrDestruct(&pThis->f_filterData.prop.pCSPropName);
+ if(pThis->f_filterData.prop.pCSCompValue != NULL)
+ rsCStrDestruct(&pThis->f_filterData.prop.pCSCompValue);
+ } else if(pThis->f_filter_type == FILTER_EXPR) {
+ if(pThis->f_filterData.f_expr != NULL)
+ expr.Destruct(&pThis->f_filterData.f_expr);
+ }
+
+ llDestroy(&pThis->llActList);
+ free(pThis);
+
+ return RS_RET_OK;
+}
+
+
+/* function to construct a selector_t object
+ * rgerhards, 2007-08-01
+ */
+rsRetVal
+selectorConstruct(selector_t **ppThis)
+{
+ DEFiRet;
+ selector_t *pThis;
+
+ assert(ppThis != NULL);
+
+ if((pThis = (selector_t*) calloc(1, sizeof(selector_t))) == NULL) {
+ ABORT_FINALIZE(RS_RET_OUT_OF_MEMORY);
+ }
+ CHKiRet(llInit(&pThis->llActList, actionDestruct, NULL, NULL));
+
+finalize_it:
+ if(iRet != RS_RET_OK) {
+ if(pThis != NULL) {
+ selectorDestruct(pThis);
+ }
+ }
+ *ppThis = pThis;
+ RETiRet;
+}
+
+
+/* rgerhards, 2005-10-24: crunch_list is called only during option processing. So
+ * it is never called once rsyslogd is running (not even when HUPed). This code
+ * contains some exits, but they are considered safe because they only happen
+ * during startup. Anyhow, when we review the code here, we might want to
+ * reconsider the exit()s.
+ */
+static char **crunch_list(char *list)
+{
+ int count, i;
+ char *p, *q;
+ char **result = NULL;
+
+ p = list;
+
+ /* strip off trailing delimiters */
+ while (p[strlen(p)-1] == LIST_DELIMITER) {
+ count--;
+ p[strlen(p)-1] = '\0';
+ }
+ /* cut off leading delimiters */
+ while (p[0] == LIST_DELIMITER) {
+ count--;
+ p++;
+ }
+
+ /* count delimiters to calculate elements */
+ for (count=i=0; p[i]; i++)
+ if (p[i] == LIST_DELIMITER) count++;
+
+ if ((result = (char **)malloc(sizeof(char *) * (count+2))) == NULL) {
+ printf ("Sorry, can't get enough memory, exiting.\n");
+ exit(0); /* safe exit, because only called during startup */
+ }
+
+ /*
+ * We now can assume that the first and last
+ * characters are different from any delimiters,
+ * so we don't have to care about this.
+ */
+ count = 0;
+ while ((q=strchr(p, LIST_DELIMITER))) {
+ result[count] = (char *) malloc((q - p + 1) * sizeof(char));
+ if (result[count] == NULL) {
+ printf ("Sorry, can't get enough memory, exiting.\n");
+ exit(0); /* safe exit, because only called during startup */
+ }
+ strncpy(result[count], p, q - p);
+ result[count][q - p] = '\0';
+ p = q; p++;
+ count++;
+ }
+ if ((result[count] = \
+ (char *)malloc(sizeof(char) * strlen(p) + 1)) == NULL) {
+ printf ("Sorry, can't get enough memory, exiting.\n");
+ exit(0); /* safe exit, because only called during startup */
+ }
+ strcpy(result[count],p);
+ result[++count] = NULL;
+
+#if 0
+ count=0;
+ while (result[count])
+ dbgprintf("#%d: %s\n", count, StripDomains[count++]);
+#endif
+ return result;
+}
+
+
+void untty(void)
+#ifdef HAVE_SETSID
+{
+ if ( !Debug ) {
+ setsid();
+ }
+ return;
+}
+#else
+{
+ int i;
+
+ if ( !Debug ) {
+ i = open(_PATH_TTY, O_RDWR);
+ if (i >= 0) {
+# if !defined(__hpux)
+ (void) ioctl(i, (int) TIOCNOTTY, (char *)0);
+# else
+ /* TODO: we need to implement something for HP UX! -- rgerhards, 2008-03-04 */
+ /* actually, HP UX should have setsid, so the code directly above should
+ * trigger. So the actual question is why it doesn't do that...
+ */
+# endif
+ (void) close(i);
+ }
+ }
+}
+#endif
+
+
+/* Take a raw input line, decode the message, and print the message
+ * on the appropriate log files.
+ * rgerhards 2004-11-08: Please note
+ * that this function does only a partial decoding. At best, it splits
+ * the PRI part. No further decode happens. The rest is done in
+ * logmsg().
+ * Added the iSource parameter so that we know if we have to parse
+ * HOSTNAME or not. rgerhards 2004-11-16.
+ * changed parameter iSource to bParseHost. For details, see comment in
+ * printchopped(). rgerhards 2005-10-06
+ * rgerhards: 2008-03-06: added "flags" to allow an input module to specify
+ * flags, most importantly to request ignoring the messages' timestamp.
+ *
+ * rgerhards, 2008-03-19:
+ * I added an additional calling parameter to permit specifying the flow
+ * control capability of the source.
+ *
+ * rgerhards, 2008-05-16:
+ * I added an additional calling parameter (hnameIP) to enable specifying the IP
+ * of a remote host.
+ *
+ * rgerhards, 2008-09-11:
+ * Interface change: added new parameter "InputName", permits the input to provide
+ * a string that identifies it. May be NULL, but must be a valid char* pointer if
+ * non-NULL.
+ */
+rsRetVal printline(uchar *hname, uchar *hnameIP, uchar *msg, int bParseHost, int flags, flowControl_t flowCtlType,
+ uchar *pszInputName)
+{
+ DEFiRet;
+ register uchar *p;
+ int pri;
+ msg_t *pMsg;
+
+ /* Now it is time to create the message object (rgerhards) */
+ CHKiRet(msgConstruct(&pMsg));
+ if(pszInputName != NULL)
+ MsgSetInputName(pMsg, (char*) pszInputName);
+ MsgSetFlowControlType(pMsg, flowCtlType);
+ MsgSetRawMsg(pMsg, (char*)msg);
+
+ pMsg->bParseHOSTNAME = bParseHost;
+ /* test for special codes */
+ pri = DEFUPRI;
+ p = msg;
+ if (*p == '<') {
+ pri = 0;
+ while (isdigit((int) *++p))
+ {
+ pri = 10 * pri + (*p - '0');
+ }
+ if (*p == '>')
+ ++p;
+ }
+ if (pri &~ (LOG_FACMASK|LOG_PRIMASK))
+ pri = DEFUPRI;
+ pMsg->iFacility = LOG_FAC(pri);
+ pMsg->iSeverity = LOG_PRI(pri);
+
+ /* Now we look at the HOSTNAME. That is a bit complicated...
+ * If we have a locally received message, it does NOT
+ * contain any hostname information in the message itself.
+ * As such, the HOSTNAME is the same as the system that
+ * the message was received from (that, for obvious reasons,
+ * being the local host). rgerhards 2004-11-16
+ */
+ if(bParseHost == 0)
+ MsgSetHOSTNAME(pMsg, (char*)hname);
+ MsgSetRcvFrom(pMsg, (char*)hname);
+ CHKiRet(MsgSetRcvFromIP(pMsg, hnameIP));
+
+ /* rgerhards 2004-11-19: well, well... we've now seen that we
+ * have the "hostname problem" also with the traditional Unix
+ * message. As we like to emulate it, we need to add the hostname
+ * to it.
+ */
+ if(MsgSetUxTradMsg(pMsg, (char*)p) != 0)
+ ABORT_FINALIZE(RS_RET_ERR);
+
+ logmsg(pMsg, flags);
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* This takes a received message that must be decoded and submits it to
+ * the main message queue. The function calls the necessary parser.
+ *
+ * rgerhards, 2006-11-30: I have greatly changed this function. Formerly,
+ * it tried to reassemble multi-part messages, which is a legacy stock
+ * sysklogd concept. In essence, that was that messages not ending with
+ * \0 were glued together. As far as I can see, this is a sysklogd
+ * specific feature and, from looking at the code, seems to be used
+ * pretty seldom (if at all). I remove this now, not the least because it is totally
+ * incompatible with upcoming IETF syslog standards. If you experience
+ * strange behaviour with messages beeing split across multiple lines,
+ * this function here might be the place to look at.
+ *
+ * Some previous history worth noting:
+ * I added the "iSource" parameter. This is needed to distinguish between
+ * messages that have a hostname in them (received from the internet) and
+ * those that do not have (most prominently /dev/log). rgerhards 2004-11-16
+ * And now I removed the "iSource" parameter and changed it to be "bParseHost",
+ * because all that it actually controls is whether the host is parsed or not.
+ * For rfc3195 support, we needed to modify the algo for host parsing, so we can
+ * no longer rely just on the source (rfc3195d forwarded messages arrive via
+ * unix domain sockets but contain the hostname). rgerhards, 2005-10-06
+ *
+ * rgerhards, 2008-02-18:
+ * This function was previously called "printchopped"() and has been renamed
+ * as part of the effort to create a clean internal message submission interface.
+ * It also has been adopted to our usual calling interface, but currently does
+ * not provide any useful return states. But we now have the hook and things can
+ * improve in the future. <-- TODO!
+ *
+ * rgerhards, 2008-03-19:
+ * I added an additional calling parameter to permit specifying the flow
+ * control capability of the source.
+ *
+ * rgerhards, 2008-05-16:
+ * I added an additional calling parameter (hnameIP) to enable specifying the IP
+ * of a remote host.
+ *
+ * rgerhards, 2008-09-11:
+ * Interface change: added new parameter "InputName", permits the input to provide
+ * a string that identifies it. May be NULL, but must be a valid char* pointer if
+ * non-NULL.
+ */
+rsRetVal
+parseAndSubmitMessage(uchar *hname, uchar *hnameIP, uchar *msg, int len, int bParseHost, int flags, flowControl_t flowCtlType,
+ uchar *pszInputName)
+{
+ DEFiRet;
+ register int iMsg;
+ uchar *pMsg;
+ uchar *pData;
+ uchar *pEnd;
+ int iMaxLine;
+ uchar *tmpline = NULL;
+# ifdef USE_NETZIP
+ uchar *deflateBuf = NULL;
+ uLongf iLenDefBuf;
+# endif
+
+ assert(hname != NULL);
+ assert(hnameIP != NULL);
+ assert(msg != NULL);
+ assert(len >= 0);
+
+ /* we first allocate work buffers large enough to hold the configured maximum
+ * size of a message. Over time, we should change this to a more optimal way, i.e.
+ * by calling the function with the actual length of the message to be parsed.
+ * rgerhards, 2008-09-02
+ *
+ * TODO: optimize buffer handling */
+ iMaxLine = glbl.GetMaxLine();
+ CHKmalloc(tmpline = malloc(sizeof(uchar) * (iMaxLine + 1)));
+# ifdef USE_NETZIP
+ CHKmalloc(deflateBuf = malloc(sizeof(uchar) * (iMaxLine + 1)));
+# endif
+
+ /* we first check if we have a NUL character at the very end of the
+ * message. This seems to be a frequent problem with a number of senders.
+ * So I have now decided to drop these NULs. However, if they are intentional,
+ * that may cause us some problems, e.g. with syslog-sign. On the other hand,
+ * current code always has problems with intentional NULs (as it needs to escape
+ * them to prevent problems with the C string libraries), so that does not
+ * really matter. Just to be on the save side, we'll log destruction of such
+ * NULs in the debug log.
+ * rgerhards, 2007-09-14
+ */
+ if(*(msg + len - 1) == '\0') {
+ dbgprintf("dropped NUL at very end of message\n");
+ len--;
+ }
+
+ /* then we check if we need to drop trailing LFs, which often make
+ * their way into syslog messages unintentionally. In order to remain
+ * compatible to recent IETF developments, we allow the user to
+ * turn on/off this handling. rgerhards, 2007-07-23
+ */
+ if(bDropTrailingLF && *(msg + len - 1) == '\n') {
+ dbgprintf("dropped LF at very end of message (DropTrailingLF is set)\n");
+ len--;
+ }
+
+ iMsg = 0; /* initialize receiving buffer index */
+ pMsg = tmpline; /* set receiving buffer pointer */
+ pData = msg; /* set source buffer pointer */
+ pEnd = msg + len; /* this is one off, which is intensional */
+
+# ifdef USE_NETZIP
+ /* we first need to check if we have a compressed record. If so,
+ * we must decompress it.
+ */
+ if(len > 0 && *msg == 'z') { /* compressed data present? (do NOT change order if conditions!) */
+ /* we have compressed data, so let's deflate it. We support a maximum
+ * message size of iMaxLine. If it is larger, an error message is logged
+ * and the message is dropped. We do NOT try to decompress larger messages
+ * as such might be used for denial of service. It might happen to later
+ * builds that such functionality be added as an optional, operator-configurable
+ * feature.
+ */
+ int ret;
+ iLenDefBuf = iMaxLine;
+ ret = uncompress((uchar *) deflateBuf, &iLenDefBuf, (uchar *) msg+1, len-1);
+ dbgprintf("Compressed message uncompressed with status %d, length: new %ld, old %d.\n",
+ ret, (long) iLenDefBuf, len-1);
+ /* Now check if the uncompression worked. If not, there is not much we can do. In
+ * that case, we log an error message but ignore the message itself. Storing the
+ * compressed text is dangerous, as it contains control characters. So we do
+ * not do this. If someone would like to have a copy, this code here could be
+ * modified to do a hex-dump of the buffer in question. We do not include
+ * this functionality right now.
+ * rgerhards, 2006-12-07
+ */
+ if(ret != Z_OK) {
+ errmsg.LogError(0, NO_ERRCODE, "Uncompression of a message failed with return code %d "
+ "- enable debug logging if you need further information. "
+ "Message ignored.", ret);
+ FINALIZE; /* unconditional exit, nothing left to do... */
+ }
+ pData = deflateBuf;
+ pEnd = deflateBuf + iLenDefBuf;
+ }
+# else /* ifdef USE_NETZIP */
+ /* in this case, we still need to check if the message is compressed. If so, we must
+ * tell the user we can not accept it.
+ */
+ if(len > 0 && *msg == 'z') {
+ errmsg.LogError(0, NO_ERRCODE, "Received a compressed message, but rsyslogd does not have compression "
+ "support enabled. The message will be ignored.");
+ FINALIZE;
+ }
+# endif /* ifdef USE_NETZIP */
+
+ while(pData < pEnd) {
+ if(iMsg >= iMaxLine) {
+ /* emergency, we now need to flush, no matter if
+ * we are at end of message or not...
+ */
+ if(iMsg == iMaxLine) {
+ *(pMsg + iMsg) = '\0'; /* space *is* reserved for this! */
+ printline(hname, hnameIP, tmpline, bParseHost, flags, flowCtlType, pszInputName);
+ } else {
+ /* This case in theory never can happen. If it happens, we have
+ * a logic error. I am checking for it, because if I would not,
+ * we would address memory invalidly with the code above. I
+ * do not care much about this case, just a debug log entry
+ * (I couldn't do any more smart things anyway...).
+ * rgerhards, 2007-9-20
+ */
+ dbgprintf("internal error: iMsg > max msg size in printchopped()\n");
+ }
+ FINALIZE; /* in this case, we are done... nothing left we can do */
+ }
+ if(*pData == '\0') { /* guard against \0 characters... */
+ /* changed to the sequence (somewhat) proposed in
+ * draft-ietf-syslog-protocol-19. rgerhards, 2006-11-30
+ */
+ if(iMsg + 3 < iMaxLine) { /* do we have space? */
+ *(pMsg + iMsg++) = cCCEscapeChar;
+ *(pMsg + iMsg++) = '0';
+ *(pMsg + iMsg++) = '0';
+ *(pMsg + iMsg++) = '0';
+ } /* if we do not have space, we simply ignore the '\0'... */
+ /* log an error? Very questionable... rgerhards, 2006-11-30 */
+ /* decided: we do not log an error, it won't help... rger, 2007-06-21 */
+ ++pData;
+ } else if(bEscapeCCOnRcv && iscntrl((int) *pData)) {
+ /* we are configured to escape control characters. Please note
+ * that this most probably break non-western character sets like
+ * Japanese, Korean or Chinese. rgerhards, 2007-07-17
+ * Note: sysklogd logs octal values only for DEL and CCs above 127.
+ * For others, it logs ^n where n is the control char converted to an
+ * alphabet character. We like consistency and thus escape it to octal
+ * in all cases. If someone complains, we may change the mode. At least
+ * we known now what's going on.
+ * rgerhards, 2007-07-17
+ */
+ if(iMsg + 3 < iMaxLine) { /* do we have space? */
+ *(pMsg + iMsg++) = cCCEscapeChar;
+ *(pMsg + iMsg++) = '0' + ((*pData & 0300) >> 6);
+ *(pMsg + iMsg++) = '0' + ((*pData & 0070) >> 3);
+ *(pMsg + iMsg++) = '0' + ((*pData & 0007));
+ } /* again, if we do not have space, we ignore the char - see comment at '\0' */
+ ++pData;
+ } else {
+ *(pMsg + iMsg++) = *pData++;
+ }
+ }
+
+ *(pMsg + iMsg) = '\0'; /* space *is* reserved for this! */
+
+ /* typically, we should end up here! */
+ printline(hname, hnameIP, tmpline, bParseHost, flags, flowCtlType, pszInputName);
+
+finalize_it:
+ if(tmpline != NULL)
+ free(tmpline);
+# ifdef USE_NETZIP
+ if(deflateBuf != NULL)
+ free(deflateBuf);
+# endif
+ RETiRet;
+}
+
+
+/* this is a special function used to submit an error message. This
+ * function is also passed to the runtime library as the generic error
+ * message handler. -- rgerhards, 2008-04-17
+ */
+rsRetVal
+submitErrMsg(int iErr, uchar *msg)
+{
+ DEFiRet;
+ iRet = logmsgInternal(iErr, LOG_SYSLOG|LOG_ERR, msg, 0);
+ RETiRet;
+}
+
+
+/* rgerhards 2004-11-09: the following is a function that can be used
+ * to log a message orginating from the syslogd itself. In sysklogd code,
+ * this is done by simply calling logmsg(). However, logmsg() is changed in
+ * rsyslog so that it takes a msg "object". So it can no longer be called
+ * directly. This method here solves the need. It provides an interface that
+ * allows to construct a locally-generated message. Please note that this
+ * function here probably is only an interim solution and that we need to
+ * think on the best way to do this.
+ */
+rsRetVal
+logmsgInternal(int iErr, int pri, uchar *msg, int flags)
+{
+ uchar pszTag[33];
+ msg_t *pMsg;
+ DEFiRet;
+
+ CHKiRet(msgConstruct(&pMsg));
+ MsgSetInputName(pMsg, "rsyslogd");
+ MsgSetUxTradMsg(pMsg, (char*)msg);
+ MsgSetRawMsg(pMsg, (char*)msg);
+ MsgSetHOSTNAME(pMsg, (char*)glbl.GetLocalHostName());
+ MsgSetRcvFrom(pMsg, (char*)glbl.GetLocalHostName());
+ MsgSetRcvFromIP(pMsg, (uchar*)"127.0.0.1");
+ /* check if we have an error code associated and, if so,
+ * adjust the tag. -- rgerhards, 2008-06-27
+ */
+ if(iErr == NO_ERRCODE) {
+ MsgSetTAG(pMsg, "rsyslogd:");
+ } else {
+ snprintf((char*)pszTag, sizeof(pszTag), "rsyslogd%d:", iErr);
+ pszTag[32] = '\0'; /* just to make sure... */
+ MsgSetTAG(pMsg, (char*)pszTag);
+ }
+ pMsg->iFacility = LOG_FAC(pri);
+ pMsg->iSeverity = LOG_PRI(pri);
+ pMsg->bParseHOSTNAME = 0;
+ flags |= INTERNAL_MSG;
+
+ /* we now check if we should print internal messages out to stderr. This was
+ * suggested by HKS as a way to help people troubleshoot rsyslog configuration
+ * (by running it interactively. This makes an awful lot of sense, so I add
+ * it here. -- rgerhards, 2008-07-28
+ * Note that error messages can not be disable during a config verify. This
+ * permits us to process unmodified config files which otherwise contain a
+ * supressor statement.
+ */
+ if(((Debug || NoFork) && bErrMsgToStderr) || iConfigVerify) {
+ if(LOG_PRI(pri) == LOG_ERR)
+ fprintf(stderr, "rsyslogd: %s\n", msg);
+ }
+
+ if(bHaveMainQueue == 0) { /* not yet in queued mode */
+ iminternalAddMsg(pri, pMsg, flags);
+ } else {
+ /* we have the queue, so we can simply provide the
+ * message to the queue engine.
+ */
+ logmsg(pMsg, flags);
+ }
+finalize_it:
+ RETiRet;
+}
+
+/* This functions looks at the given message and checks if it matches the
+ * provided filter condition. If so, it returns true, else it returns
+ * false. This is a helper to logmsg() and meant to drive the decision
+ * process if a message is to be processed or not. As I expect this
+ * decision code to grow more complex over time AND logmsg() is already
+ * a very lengthy function, I thought a separate function is more appropriate.
+ * 2005-09-19 rgerhards
+ * 2008-02-25 rgerhards: changed interface, now utilizes iRet, bProcessMsg
+ * returns is message should be procesed.
+ */
+static rsRetVal shouldProcessThisMessage(selector_t *f, msg_t *pMsg, int *bProcessMsg)
+{
+ DEFiRet;
+ unsigned short pbMustBeFreed;
+ char *pszPropVal;
+ int bRet = 0;
+ vm_t *pVM = NULL;
+ var_t *pResult = NULL;
+
+ assert(f != NULL);
+ assert(pMsg != NULL);
+
+ /* we first have a look at the global, BSD-style block filters (for tag
+ * and host). Only if they match, we evaluate the actual filter.
+ * rgerhards, 2005-10-18
+ */
+ if(f->eHostnameCmpMode == HN_NO_COMP) {
+ /* EMPTY BY INTENSION - we check this value first, because
+ * it is the one most often used, so this saves us time!
+ */
+ } else if(f->eHostnameCmpMode == HN_COMP_MATCH) {
+ if(rsCStrSzStrCmp(f->pCSHostnameComp, (uchar*) getHOSTNAME(pMsg), getHOSTNAMELen(pMsg))) {
+ /* not equal, so we are already done... */
+ dbgprintf("hostname filter '+%s' does not match '%s'\n",
+ rsCStrGetSzStrNoNULL(f->pCSHostnameComp), getHOSTNAME(pMsg));
+ FINALIZE;
+ }
+ } else { /* must be -hostname */
+ if(!rsCStrSzStrCmp(f->pCSHostnameComp, (uchar*) getHOSTNAME(pMsg), getHOSTNAMELen(pMsg))) {
+ /* not equal, so we are already done... */
+ dbgprintf("hostname filter '-%s' does not match '%s'\n",
+ rsCStrGetSzStrNoNULL(f->pCSHostnameComp), getHOSTNAME(pMsg));
+ FINALIZE;
+ }
+ }
+
+ if(f->pCSProgNameComp != NULL) {
+ int bInv = 0, bEqv = 0, offset = 0;
+ if(*(rsCStrGetSzStrNoNULL(f->pCSProgNameComp)) == '-') {
+ if(*(rsCStrGetSzStrNoNULL(f->pCSProgNameComp) + 1) == '-')
+ offset = 1;
+ else {
+ bInv = 1;
+ offset = 1;
+ }
+ }
+ if(!rsCStrOffsetSzStrCmp(f->pCSProgNameComp, offset, (uchar*) getProgramName(pMsg), getProgramNameLen(pMsg)))
+ bEqv = 1;
+
+ if((!bEqv && !bInv) || (bEqv && bInv)) {
+ /* not equal or inverted selection, so we are already done... */
+ dbgprintf("programname filter '%s' does not match '%s'\n",
+ rsCStrGetSzStrNoNULL(f->pCSProgNameComp), getProgramName(pMsg));
+ FINALIZE;
+ }
+ }
+
+ /* done with the BSD-style block filters */
+
+ if(f->f_filter_type == FILTER_PRI) {
+ /* skip messages that are incorrect priority */
+ if ( (f->f_filterData.f_pmask[pMsg->iFacility] == TABLE_NOPRI) || \
+ ((f->f_filterData.f_pmask[pMsg->iFacility] & (1<<pMsg->iSeverity)) == 0) )
+ bRet = 0;
+ else
+ bRet = 1;
+ } else if(f->f_filter_type == FILTER_EXPR) {
+ CHKiRet(vm.Construct(&pVM));
+ CHKiRet(vm.ConstructFinalize(pVM));
+ CHKiRet(vm.SetMsg(pVM, pMsg));
+ CHKiRet(vm.ExecProg(pVM, f->f_filterData.f_expr->pVmprg));
+ CHKiRet(vm.PopBoolFromStack(pVM, &pResult));
+ dbgprintf("result of expression evaluation: %lld\n", pResult->val.num);
+ /* VM is destructed on function exit */
+ bRet = (pResult->val.num) ? 1 : 0;
+ } else {
+ assert(f->f_filter_type == FILTER_PROP); /* assert() just in case... */
+ pszPropVal = MsgGetProp(pMsg, NULL, f->f_filterData.prop.pCSPropName, &pbMustBeFreed);
+
+ /* Now do the compares (short list currently ;)) */
+ switch(f->f_filterData.prop.operation ) {
+ case FIOP_CONTAINS:
+ if(rsCStrLocateInSzStr(f->f_filterData.prop.pCSCompValue, (uchar*) pszPropVal) != -1)
+ bRet = 1;
+ break;
+ case FIOP_ISEQUAL:
+ if(rsCStrSzStrCmp(f->f_filterData.prop.pCSCompValue,
+ (uchar*) pszPropVal, strlen(pszPropVal)) == 0)
+ bRet = 1; /* process message! */
+ break;
+ case FIOP_STARTSWITH:
+ if(rsCStrSzStrStartsWithCStr(f->f_filterData.prop.pCSCompValue,
+ (uchar*) pszPropVal, strlen(pszPropVal)) == 0)
+ bRet = 1; /* process message! */
+ break;
+ case FIOP_REGEX:
+ if(rsCStrSzStrMatchRegex(f->f_filterData.prop.pCSCompValue,
+ (unsigned char*) pszPropVal) == 0)
+ bRet = 1;
+ break;
+ default:
+ /* here, it handles NOP (for performance reasons) */
+ assert(f->f_filterData.prop.operation == FIOP_NOP);
+ bRet = 1; /* as good as any other default ;) */
+ break;
+ }
+
+ /* now check if the value must be negated */
+ if(f->f_filterData.prop.isNegated)
+ bRet = (bRet == 1) ? 0 : 1;
+
+ if(Debug) {
+ dbgprintf("Filter: check for property '%s' (value '%s') ",
+ rsCStrGetSzStrNoNULL(f->f_filterData.prop.pCSPropName),
+ pszPropVal);
+ if(f->f_filterData.prop.isNegated)
+ dbgprintf("NOT ");
+ dbgprintf("%s '%s': %s\n",
+ getFIOPName(f->f_filterData.prop.operation),
+ rsCStrGetSzStrNoNULL(f->f_filterData.prop.pCSCompValue),
+ bRet ? "TRUE" : "FALSE");
+ }
+
+ /* cleanup */
+ if(pbMustBeFreed)
+ free(pszPropVal);
+ }
+
+finalize_it:
+ /* destruct in any case, not just on error, but it makes error handling much easier */
+ if(pVM != NULL)
+ vm.Destruct(&pVM);
+
+ if(pResult != NULL)
+ var.Destruct(&pResult);
+
+ *bProcessMsg = bRet;
+ RETiRet;
+}
+
+
+/* helper to processMsg(), used to call the configured actions. It is
+ * executed from within llExecFunc() of the action list.
+ * rgerhards, 2007-08-02
+ */
+typedef struct processMsgDoActions_s {
+ int bPrevWasSuspended; /* was the previous action suspended? */
+ msg_t *pMsg;
+} processMsgDoActions_t;
+DEFFUNC_llExecFunc(processMsgDoActions)
+{
+ DEFiRet;
+ rsRetVal iRetMod; /* return value of module - we do not always pass that back */
+ action_t *pAction = (action_t*) pData;
+ processMsgDoActions_t *pDoActData = (processMsgDoActions_t*) pParam;
+
+ assert(pAction != NULL);
+
+ if((pAction->bExecWhenPrevSusp == 1) && (pDoActData->bPrevWasSuspended == 0)) {
+ dbgprintf("not calling action because the previous one is not suspended\n");
+ ABORT_FINALIZE(RS_RET_OK);
+ }
+
+ iRetMod = actionCallAction(pAction, pDoActData->pMsg);
+ if(iRetMod == RS_RET_DISCARDMSG) {
+ ABORT_FINALIZE(RS_RET_DISCARDMSG);
+ } else if(iRetMod == RS_RET_SUSPENDED) {
+ /* indicate suspension for next module to be called */
+ pDoActData->bPrevWasSuspended = 1;
+ } else {
+ pDoActData->bPrevWasSuspended = 0;
+ }
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* Process (consume) a received message. Calls the actions configured.
+ * rgerhards, 2005-10-13
+ */
+static void
+processMsg(msg_t *pMsg)
+{
+ selector_t *f;
+ int bContinue;
+ int bProcessMsg;
+ processMsgDoActions_t DoActData;
+ rsRetVal iRet;
+
+ BEGINfunc
+ assert(pMsg != NULL);
+
+ /* log the message to the particular outputs */
+
+ bContinue = 1;
+ for (f = Files; f != NULL && bContinue ; f = f->f_next) {
+ /* first check the filters... */
+ iRet = shouldProcessThisMessage(f, pMsg, &bProcessMsg);
+ if(!bProcessMsg) {
+ continue;
+ }
+
+ /* ok -- from here, we have action-specific code, nothing really selector-specific -- rger 2007-08-01 */
+ DoActData.pMsg = pMsg;
+ DoActData.bPrevWasSuspended = 0;
+ if(llExecFunc(&f->llActList, processMsgDoActions, (void*)&DoActData) == RS_RET_DISCARDMSG)
+ bContinue = 0;
+ }
+ ENDfunc
+}
+
+
+/* The consumer of dequeued messages. This function is called by the
+ * queue engine on dequeueing of a message. It runs on a SEPARATE
+ * THREAD.
+ * Please note: the message object is destructed by the queue itself!
+ */
+static rsRetVal
+msgConsumer(void __attribute__((unused)) *notNeeded, void *pUsr)
+{
+ DEFiRet;
+ msg_t *pMsg = (msg_t*) pUsr;
+
+ assert(pMsg != NULL);
+
+ processMsg(pMsg);
+ msgDestruct(&pMsg);
+
+ RETiRet;
+}
+
+
+/* Helper to parseRFCSyslogMsg. This function parses a field up to
+ * (and including) the SP character after it. The field contents is
+ * returned in a caller-provided buffer. The parsepointer is advanced
+ * to after the terminating SP. The caller must ensure that the
+ * provided buffer is large enough to hold the to be extracted value.
+ * Returns 0 if everything is fine or 1 if either the field is not
+ * SP-terminated or any other error occurs.
+ * rger, 2005-11-24
+ */
+static int parseRFCField(char **pp2parse, char *pResult)
+{
+ char *p2parse;
+ int iRet = 0;
+
+ assert(pp2parse != NULL);
+ assert(*pp2parse != NULL);
+ assert(pResult != NULL);
+
+ p2parse = *pp2parse;
+
+ /* this is the actual parsing loop */
+ while(*p2parse && *p2parse != ' ') {
+ *pResult++ = *p2parse++;
+ }
+
+ if(*p2parse == ' ')
+ ++p2parse; /* eat SP, but only if not at end of string */
+ else
+ iRet = 1; /* there MUST be an SP! */
+ *pResult = '\0';
+
+ /* set the new parse pointer */
+ *pp2parse = p2parse;
+ return 0;
+}
+
+
+/* Helper to parseRFCSyslogMsg. This function parses the structured
+ * data field of a message. It does NOT parse inside structured data,
+ * just gets the field as whole. Parsing the single entities is left
+ * to other functions. The parsepointer is advanced
+ * to after the terminating SP. The caller must ensure that the
+ * provided buffer is large enough to hold the to be extracted value.
+ * Returns 0 if everything is fine or 1 if either the field is not
+ * SP-terminated or any other error occurs.
+ * rger, 2005-11-24
+ */
+static int parseRFCStructuredData(char **pp2parse, char *pResult)
+{
+ char *p2parse;
+ int bCont = 1;
+ int iRet = 0;
+
+ assert(pp2parse != NULL);
+ assert(*pp2parse != NULL);
+ assert(pResult != NULL);
+
+ p2parse = *pp2parse;
+
+ /* this is the actual parsing loop
+ * Remeber: structured data starts with [ and includes any characters
+ * until the first ] followed by a SP. There may be spaces inside
+ * structured data. There may also be \] inside the structured data, which
+ * do NOT terminate an element.
+ */
+ if(*p2parse != '[')
+ return 1; /* this is NOT structured data! */
+
+ if(*p2parse == '-') { /* empty structured data? */
+ *pResult++ = '-';
+ ++p2parse;
+ } else {
+ while(bCont) {
+ if(*p2parse == '\0') {
+ iRet = 1; /* this is not valid! */
+ bCont = 0;
+ } else if(*p2parse == '\\' && *(p2parse+1) == ']') {
+ /* this is escaped, need to copy both */
+ *pResult++ = *p2parse++;
+ *pResult++ = *p2parse++;
+ } else if(*p2parse == ']' && *(p2parse+1) == ' ') {
+ /* found end, just need to copy the ] and eat the SP */
+ *pResult++ = *p2parse;
+ p2parse += 2;
+ bCont = 0;
+ } else {
+ *pResult++ = *p2parse++;
+ }
+ }
+ }
+
+ if(*p2parse == ' ')
+ ++p2parse; /* eat SP, but only if not at end of string */
+ else
+ iRet = 1; /* there MUST be an SP! */
+ *pResult = '\0';
+
+ /* set the new parse pointer */
+ *pp2parse = p2parse;
+ return 0;
+}
+
+/* parse a RFC-formatted syslog message. This function returns
+ * 0 if processing of the message shall continue and 1 if something
+ * went wrong and this messe should be ignored. This function has been
+ * implemented in the effort to support syslog-protocol. Please note that
+ * the name (parse *RFC*) stems from the hope that syslog-protocol will
+ * some time become an RFC. Do not confuse this with informational
+ * RFC 3164 (which is legacy syslog).
+ *
+ * currently supported format:
+ *
+ * <PRI>VERSION SP TIMESTAMP SP HOSTNAME SP APP-NAME SP PROCID SP MSGID SP [SD-ID]s SP MSG
+ *
+ * <PRI> is already stripped when this function is entered. VERSION already
+ * has been confirmed to be "1", but has NOT been stripped from the message.
+ *
+ * rger, 2005-11-24
+ */
+static int parseRFCSyslogMsg(msg_t *pMsg, int flags)
+{
+ char *p2parse;
+ char *pBuf;
+ int bContParse = 1;
+
+ assert(pMsg != NULL);
+ assert(pMsg->pszUxTradMsg != NULL);
+ p2parse = (char*) pMsg->pszUxTradMsg;
+
+ /* do a sanity check on the version and eat it */
+ assert(p2parse[0] == '1' && p2parse[1] == ' ');
+ p2parse += 2;
+
+ /* Now get us some memory we can use as a work buffer while parsing.
+ * We simply allocated a buffer sufficiently large to hold all of the
+ * message, so we can not run into any troubles. I think this is
+ * more wise then to use individual buffers.
+ */
+ if((pBuf = malloc(sizeof(char)* strlen(p2parse) + 1)) == NULL)
+ return 1;
+
+ /* IMPORTANT NOTE:
+ * Validation is not actually done below nor are any errors handled. I have
+ * NOT included this for the current proof of concept. However, it is strongly
+ * advisable to add it when this code actually goes into production.
+ * rgerhards, 2005-11-24
+ */
+
+ /* TIMESTAMP */
+ if(datetime.ParseTIMESTAMP3339(&(pMsg->tTIMESTAMP), &p2parse) == RS_RET_OK) {
+ if(flags & IGNDATE) {
+ /* we need to ignore the msg data, so simply copy over reception date */
+ memcpy(&pMsg->tTIMESTAMP, &pMsg->tRcvdAt, sizeof(struct syslogTime));
+ }
+ } else {
+ dbgprintf("no TIMESTAMP detected!\n");
+ bContParse = 0;
+ }
+
+ /* HOSTNAME */
+ if(bContParse) {
+ parseRFCField(&p2parse, pBuf);
+ MsgSetHOSTNAME(pMsg, pBuf);
+ } else {
+ /* we can not parse, so we get the system we
+ * received the data from.
+ */
+ MsgSetHOSTNAME(pMsg, getRcvFrom(pMsg));
+ }
+
+ /* APP-NAME */
+ if(bContParse) {
+ parseRFCField(&p2parse, pBuf);
+ MsgSetAPPNAME(pMsg, pBuf);
+ }
+
+ /* PROCID */
+ if(bContParse) {
+ parseRFCField(&p2parse, pBuf);
+ MsgSetPROCID(pMsg, pBuf);
+ }
+
+ /* MSGID */
+ if(bContParse) {
+ parseRFCField(&p2parse, pBuf);
+ MsgSetMSGID(pMsg, pBuf);
+ }
+
+ /* STRUCTURED-DATA */
+ if(bContParse) {
+ parseRFCStructuredData(&p2parse, pBuf);
+ MsgSetStructuredData(pMsg, pBuf);
+ }
+
+ /* MSG */
+ MsgSetMSG(pMsg, p2parse);
+
+ free(pBuf);
+ return 0; /* all ok */
+}
+
+
+/* parse a legay-formatted syslog message. This function returns
+ * 0 if processing of the message shall continue and 1 if something
+ * went wrong and this messe should be ignored. This function has been
+ * implemented in the effort to support syslog-protocol.
+ * rger, 2005-11-24
+ * As of 2006-01-10, I am removing the logic to continue parsing only
+ * when a valid TIMESTAMP is detected. Validity of other fields already
+ * is ignored. This is due to the fact that the parser has grown smarter
+ * and is now more able to understand different dialects of the syslog
+ * message format. I do not expect any bad side effects of this change,
+ * but I thought I log it in this comment.
+ * rgerhards, 2006-01-10
+ */
+static int parseLegacySyslogMsg(msg_t *pMsg, int flags)
+{
+ char *p2parse;
+ char *pBuf;
+ char *pWork;
+ cstr_t *pStrB;
+ int iCnt;
+ int bTAGCharDetected;
+ BEGINfunc
+
+ assert(pMsg != NULL);
+ assert(pMsg->pszUxTradMsg != NULL);
+ p2parse = (char*) pMsg->pszUxTradMsg;
+
+ /* Check to see if msg contains a timestamp. We start by assuming
+ * that the message timestamp is the time of reciption (which we
+ * generated ourselfs and then try to actually find one inside the
+ * message. There we go from high-to low precison and are done
+ * when we find a matching one. -- rgerhards, 2008-09-16
+ */
+ if(datetime.ParseTIMESTAMP3339(&(pMsg->tTIMESTAMP), &p2parse) == RS_RET_OK) {
+ /* we are done - parse pointer is moved by ParseTIMESTAMP3339 */;
+ } else if(datetime.ParseTIMESTAMP3164(&(pMsg->tTIMESTAMP), &p2parse) == RS_RET_OK) {
+ /* we are done - parse pointer is moved by ParseTIMESTAMP3164 */;
+ } else if(*p2parse == ' ') { /* try to see if it is slighly malformed - HP procurve seems to do that sometimes */
+ ++p2parse; /* move over space */
+ if(datetime.ParseTIMESTAMP3164(&(pMsg->tTIMESTAMP), &p2parse) == RS_RET_OK) {
+ /* indeed, we got it! */
+ /* we are done - parse pointer is moved by ParseTIMESTAMP3164 */;
+ } else {
+ /* parse pointer needs to be restored, as we moved it off-by-one
+ * for this try.
+ */
+ --p2parse;
+ }
+ }
+
+ if(flags & IGNDATE) {
+ /* we need to ignore the msg data, so simply copy over reception date */
+ memcpy(&pMsg->tTIMESTAMP, &pMsg->tRcvdAt, sizeof(struct syslogTime));
+ }
+
+ /* rgerhards, 2006-03-13: next, we parse the hostname and tag. But we
+ * do this only when the user has not forbidden this. I now introduce some
+ * code that allows a user to configure rsyslogd to treat the rest of the
+ * message as MSG part completely. In this case, the hostname will be the
+ * machine that we received the message from and the tag will be empty. This
+ * is meant to be an interim solution, but for now it is in the code.
+ */
+ if(bParseHOSTNAMEandTAG && !(flags & INTERNAL_MSG)) {
+ /* parse HOSTNAME - but only if this is network-received!
+ * rger, 2005-11-14: we still have a problem with BSD messages. These messages
+ * do NOT include a host name. In most cases, this leads to the TAG to be treated
+ * as hostname and the first word of the message as the TAG. Clearly, this is not
+ * of advantage ;) I think I have now found a way to handle this situation: there
+ * are certain characters which are frequently used in TAG (e.g. ':'), which are
+ * *invalid* in host names. So while parsing the hostname, I check for these characters.
+ * If I find them, I set a simple flag but continue. After parsing, I check the flag.
+ * If it was set, then we most probably do not have a hostname but a TAG. Thus, I change
+ * the fields. I think this logic shall work with any type of syslog message.
+ */
+ bTAGCharDetected = 0;
+ if(pMsg->bParseHOSTNAME) {
+ /* TODO: quick and dirty memory allocation */
+ /* the memory allocated is far too much in most cases. But on the plus side,
+ * it is quite fast... - rgerhards, 2007-09-20
+ */
+ if((pBuf = malloc(sizeof(char)* (strlen(p2parse) +1))) == NULL)
+ return 1;
+ pWork = pBuf;
+ /* this is the actual parsing loop */
+ while(*p2parse && *p2parse != ' ' && *p2parse != ':') {
+ if(*p2parse == '[' || *p2parse == ']' || *p2parse == '/')
+ bTAGCharDetected = 1;
+ *pWork++ = *p2parse++;
+ }
+ /* we need to handle ':' seperately, because it terminates the
+ * TAG - so we also need to terminate the parser here!
+ * rgerhards, 2007-09-10 *p2parse points to a valid address here in
+ * any case. We can reach this point only if we are at end of string,
+ * or we have a ':' or ' '. What the if below does is check if we are
+ * not at end of string and, if so, advance the parse pointer. If we
+ * are already at end of string, *p2parse is equal to '\0', neither if
+ * will be true and the parse pointer remain as is. This is perfectly
+ * well.
+ */
+ if(*p2parse == ':') {
+ bTAGCharDetected = 1;
+ /* We will move hostname to tag, so preserve ':' (otherwise we
+ * will needlessly change the message format) */
+ *pWork++ = *p2parse++;
+ } else if(*p2parse == ' ')
+ ++p2parse;
+ *pWork = '\0';
+ MsgAssignHOSTNAME(pMsg, pBuf);
+ }
+ /* check if we seem to have a TAG */
+ if(bTAGCharDetected) {
+ /* indeed, this smells like a TAG, so lets use it for this. We take
+ * the HOSTNAME from the sender system instead.
+ */
+ dbgprintf("HOSTNAME contains invalid characters, assuming it to be a TAG.\n");
+ moveHOSTNAMEtoTAG(pMsg);
+ MsgSetHOSTNAME(pMsg, getRcvFrom(pMsg));
+ }
+
+ /* now parse TAG - that should be present in message from all sources.
+ * This code is somewhat not compliant with RFC 3164. As of 3164,
+ * the TAG field is ended by any non-alphanumeric character. In
+ * practice, however, the TAG often contains dashes and other things,
+ * which would end the TAG. So it is not desirable. As such, we only
+ * accept colon and SP to be terminators. Even there is a slight difference:
+ * a colon is PART of the TAG, while a SP is NOT part of the tag
+ * (it is CONTENT). Starting 2008-04-04, we have removed the 32 character
+ * size limit (from RFC3164) on the tag. This had bad effects on existing
+ * envrionments, as sysklogd didn't obey it either (probably another bug
+ * in RFC3164...). We now receive the full size, but will modify the
+ * outputs so that only 32 characters max are used by default.
+ */
+ /* The following code in general is quick & dirty - I need to get
+ * it going for a test, rgerhards 2004-11-16 */
+ /* lol.. we tried to solve it, just to remind ourselfs that 32 octets
+ * is the max size ;) we need to shuffle the code again... Just for
+ * the records: the code is currently clean, but we could optimize it! */
+ if(!bTAGCharDetected) {
+ uchar *pszTAG;
+ if(rsCStrConstruct(&pStrB) != RS_RET_OK)
+ return 1;
+ rsCStrSetAllocIncrement(pStrB, 33);
+ pWork = pBuf;
+ iCnt = 0;
+ while(*p2parse && *p2parse != ':' && *p2parse != ' ') {
+ rsCStrAppendChar(pStrB, *p2parse++);
+ ++iCnt;
+ }
+ if(*p2parse == ':') {
+ ++p2parse;
+ rsCStrAppendChar(pStrB, ':');
+ }
+ rsCStrFinish(pStrB);
+
+ rsCStrConvSzStrAndDestruct(pStrB, &pszTAG, 1);
+ if(pszTAG == NULL)
+ { /* rger, 2005-11-10: no TAG found - this implies that what
+ * we have considered to be the HOSTNAME is most probably the
+ * TAG. We consider it so probable, that we now adjust it
+ * that way. So we pick up the previously set hostname, assign
+ * it to tag and use the sender system (from IP stack) as
+ * the hostname. This situation is the standard case with
+ * stock BSD syslogd.
+ */
+ dbgprintf("No TAG in message, assuming that HOSTNAME is missing.\n");
+ moveHOSTNAMEtoTAG(pMsg);
+ MsgSetHOSTNAME(pMsg, getRcvFrom(pMsg));
+ } else { /* we have a TAG, so we can happily set it ;) */
+ MsgAssignTAG(pMsg, pszTAG);
+ }
+ } else {
+ /* we have no TAG, so we ... */
+ /*DO NOTHING*/;
+ }
+ } else {
+ /* we enter this code area when the user has instructed rsyslog NOT
+ * to parse HOSTNAME and TAG - rgerhards, 2006-03-13
+ */
+ if(!(flags & INTERNAL_MSG))
+ {
+ dbgprintf("HOSTNAME and TAG not parsed by user configuraton.\n");
+ MsgSetHOSTNAME(pMsg, getRcvFrom(pMsg));
+ }
+ }
+
+ /* The rest is the actual MSG */
+ MsgSetMSG(pMsg, p2parse);
+
+ ENDfunc
+ return 0; /* all ok */
+}
+
+
+/* submit a fully created message to the main message queue. The message is
+ * fully processed and parsed, so no parsing at all happens. This is primarily
+ * a hook to prevent the need for callers to know about the main message queue
+ * (which may change in the future as we will probably have multiple rule
+ * sets and thus queues...).
+ * rgerhards, 2008-02-13
+ */
+rsRetVal
+submitMsg(msg_t *pMsg)
+{
+ DEFiRet;
+
+ ISOBJ_TYPE_assert(pMsg, msg);
+
+ MsgPrepareEnqueue(pMsg);
+ queueEnqObj(pMsgQueue, pMsg->flowCtlType, (void*) pMsg);
+
+ RETiRet;
+}
+
+
+/* Log a message to the appropriate log files, users, etc. based on
+ * the priority.
+ * rgerhards 2004-11-08: actually, this also decodes all but the PRI part.
+ * rgerhards 2004-11-09: ... but only, if syslogd could properly be initialized
+ * if not, we use emergency logging to the console and in
+ * this case, no further decoding happens.
+ * changed to no longer receive a plain message but a msg object instead.
+ * rgerhards-2004-11-16: OK, we are now up to another change... This method
+ * actually needs to PARSE the message. How exactly this needs to happen depends on
+ * a number of things. Most importantly, it depends on the source. For example,
+ * locally received messages (SOURCE_UNIXAF) do NOT have a hostname in them. So
+ * we need to treat them differntly form network-received messages which have.
+ * Well, actually not all network-received message really have a hostname. We
+ * can just hope they do, but we can not be sure. So this method tries to find
+ * whatever can be found in the message and uses that... Obviously, there is some
+ * potential for misinterpretation, which we simply can not solve under the
+ * circumstances given.
+ */
+void
+logmsg(msg_t *pMsg, int flags)
+{
+ char *msg;
+
+ BEGINfunc
+ assert(pMsg != NULL);
+ assert(pMsg->pszUxTradMsg != NULL);
+ msg = (char*) pMsg->pszUxTradMsg;
+ dbgprintf("logmsg: flags %x, from '%s', msg %s\n", flags, getRcvFrom(pMsg), msg);
+
+ /* rger 2005-11-24 (happy thanksgiving!): we now need to check if we have
+ * a traditional syslog message or one formatted according to syslog-protocol.
+ * We need to apply different parsers depending on that. We use the
+ * -protocol VERSION field for the detection.
+ */
+ if(msg[0] == '1' && msg[1] == ' ') {
+ dbgprintf("Message has syslog-protocol format.\n");
+ setProtocolVersion(pMsg, 1);
+ if(parseRFCSyslogMsg(pMsg, flags) == 1) {
+ msgDestruct(&pMsg);
+ return;
+ }
+ } else { /* we have legacy syslog */
+ dbgprintf("Message has legacy syslog format.\n");
+ setProtocolVersion(pMsg, 0);
+ if(parseLegacySyslogMsg(pMsg, flags) == 1) {
+ msgDestruct(&pMsg);
+ return;
+ }
+ }
+
+ /* ---------------------- END PARSING ---------------- */
+
+ /* now submit the message to the main queue - then we are done */
+ pMsg->msgFlags = flags;
+ MsgPrepareEnqueue(pMsg);
+ queueEnqObj(pMsgQueue, pMsg->flowCtlType, (void*) pMsg);
+ ENDfunc
+}
+
+
+static void
+reapchild()
+{
+ int saved_errno = errno;
+ struct sigaction sigAct;
+
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+ sigAct.sa_handler = reapchild;
+ sigaction(SIGCHLD, &sigAct, NULL); /* reset signal handler -ASP */
+
+ while(waitpid(-1, NULL, WNOHANG) > 0);
+ errno = saved_errno;
+}
+
+
+/* helper to doFlushRptdMsgs() to flush the individual action links via llExecFunc
+ * rgerhards, 2007-08-02
+ */
+DEFFUNC_llExecFunc(flushRptdMsgsActions)
+{
+ action_t *pAction = (action_t*) pData;
+
+ assert(pAction != NULL);
+
+ BEGINfunc
+ LockObj(pAction);
+ /* TODO: time() performance: the call below could be moved to
+ * the beginn of the llExec(). This makes it slightly less correct, but
+ * in an acceptable way. -- rgerhards, 2008-09-16
+ */
+ if (pAction->f_prevcount && time(NULL) >= REPEATTIME(pAction)) {
+ dbgprintf("flush %s: repeated %d times, %d sec.\n",
+ module.GetStateName(pAction->pMod), pAction->f_prevcount,
+ repeatinterval[pAction->f_repeatcount]);
+ actionWriteToAction(pAction);
+ BACKOFF(pAction);
+ }
+ UnlockObj(pAction);
+
+ ENDfunc
+ return RS_RET_OK; /* we ignore errors, we can not do anything either way */
+}
+
+
+/* This method flushes reapeat messages.
+ */
+static void
+doFlushRptdMsgs(void)
+{
+ register selector_t *f;
+
+ /* see if we need to flush any "message repeated n times"...
+ * Note that this interferes with objects running on other threads.
+ * We are using appropriate locking inside the function to handle that.
+ */
+ for (f = Files; f != NULL ; f = f->f_next) {
+ llExecFunc(&f->llActList, flushRptdMsgsActions, NULL);
+ }
+}
+
+
+static void debug_switch()
+{
+ struct sigaction sigAct;
+
+ if(debugging_on == 0) {
+ debugging_on = 1;
+ dbgprintf("Switching debugging_on to true\n");
+ } else {
+ dbgprintf("Switching debugging_on to false\n");
+ debugging_on = 0;
+ }
+
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+ sigAct.sa_handler = debug_switch;
+ sigaction(SIGUSR1, &sigAct, NULL);
+}
+
+
+void legacyOptsEnq(uchar *line)
+{
+ legacyOptsLL_t *pNew;
+
+ pNew = malloc(sizeof(legacyOptsLL_t));
+ if(line == NULL)
+ pNew->line = NULL;
+ else
+ pNew->line = (uchar *) strdup((char *) line);
+ pNew->next = NULL;
+
+ if(pLegacyOptsLL == NULL)
+ pLegacyOptsLL = pNew;
+ else {
+ legacyOptsLL_t *pThis = pLegacyOptsLL;
+
+ while(pThis->next != NULL)
+ pThis = pThis->next;
+ pThis->next = pNew;
+ }
+}
+
+
+void legacyOptsFree(void)
+{
+ legacyOptsLL_t *pThis = pLegacyOptsLL, *pNext;
+
+ while(pThis != NULL) {
+ if(pThis->line != NULL)
+ free(pThis->line);
+ pNext = pThis->next;
+ free(pThis);
+ pThis = pNext;
+ }
+}
+
+
+void legacyOptsHook(void)
+{
+ legacyOptsLL_t *pThis = pLegacyOptsLL;
+
+ while(pThis != NULL) {
+ if(pThis->line != NULL) {
+ errno = 0;
+ errmsg.LogError(0, NO_ERRCODE, "Warning: backward compatibility layer added to following "
+ "directive to rsyslog.conf: %s", pThis->line);
+ conf.cfsysline(pThis->line);
+ }
+ pThis = pThis->next;
+ }
+}
+
+
+void legacyOptsParseTCP(char ch, char *arg)
+{
+ register int i;
+ register char *pArg = arg;
+ static char conflict = '\0';
+
+ if((conflict == 'g' && ch == 't') || (conflict == 't' && ch == 'g')) {
+ fprintf(stderr, "rsyslogd: If you want to use both -g and -t, use directives instead, -%c ignored.\n", ch);
+ return;
+ } else
+ conflict = ch;
+
+ /* extract port */
+ i = 0;
+ while(isdigit((int) *pArg))
+ i = i * 10 + *pArg++ - '0';
+
+ /* number of sessions */
+ if(*pArg == '\0' || *pArg == ',') {
+ if(ch == 't')
+ legacyOptsEnq((uchar *) "ModLoad imtcp");
+ else if(ch == 'g')
+ legacyOptsEnq((uchar *) "ModLoad imgssapi");
+
+ if(i >= 0 && i <= 65535) {
+ uchar line[30];
+
+ if(ch == 't') {
+ snprintf((char *) line, sizeof(line), "InputTCPServerRun %d", i);
+ } else if(ch == 'g') {
+ snprintf((char *) line, sizeof(line), "InputGSSServerRun %d", i);
+ }
+ legacyOptsEnq(line);
+ } else {
+ if(ch == 't') {
+ fprintf(stderr, "rsyslogd: Invalid TCP listen port %d - changed to 514.\n", i);
+ legacyOptsEnq((uchar *) "InputTCPServerRun 514");
+ } else if(ch == 'g') {
+ fprintf(stderr, "rsyslogd: Invalid GSS listen port %d - changed to 514.\n", i);
+ legacyOptsEnq((uchar *) "InputGSSServerRun 514");
+ }
+ }
+
+ if(*pArg == ',') {
+ ++pArg;
+ while(isspace((int) *pArg))
+ ++pArg;
+ i = 0;
+ while(isdigit((int) *pArg)) {
+ i = i * 10 + *pArg++ - '0';
+ }
+ if(i > 0) {
+ uchar line[30];
+
+ snprintf((char *) line, sizeof(line), "InputTCPMaxSessions %d", i);
+ legacyOptsEnq(line);
+ } else {
+ if(ch == 't') {
+ fprintf(stderr, "rsyslogd: TCP session max configured "
+ "to %d [-t %s] - changing to 1.\n", i, arg);
+ legacyOptsEnq((uchar *) "InputTCPMaxSessions 1");
+ } else if (ch == 'g') {
+ fprintf(stderr, "rsyslogd: GSS session max configured "
+ "to %d [-g %s] - changing to 1.\n", i, arg);
+ legacyOptsEnq((uchar *) "InputTCPMaxSessions 1");
+ }
+ }
+ }
+ } else
+ fprintf(stderr, "rsyslogd: Invalid -t %s command line option.\n", arg);
+}
+
+
+/* doDie() is a signal handler. If called, it sets the bFinished variable
+ * to indicate the program should terminate. However, it does not terminate
+ * it itself, because that causes issues with multi-threading. The actual
+ * termination is then done on the main thread. This solution might introduce
+ * a minimal delay, but it is much cleaner than the approach of doing everything
+ * inside the signal handler.
+ * rgerhards, 2005-10-26
+ * Note: we do not call dbgprintf() as this may cause us to block in case something
+ * with the threading is wrong.
+ */
+static void doDie(int sig)
+{
+# define MSG1 "DoDie called.\n"
+# define MSG2 "DoDie called 5 times - unconditional exit\n"
+ static int iRetries = 0; /* debug aid */
+ if(Debug)
+ write(1, MSG1, sizeof(MSG1) - 1);
+ if(iRetries++ == 4) {
+ if(Debug)
+ write(1, MSG2, sizeof(MSG2) - 1);
+ abort();
+ }
+ bFinished = sig;
+# undef MSG1
+# undef MSG2
+}
+
+
+/* This function frees all dynamically allocated memory for program termination.
+ * It must be called only immediately before exit(). It is primarily an aid
+ * for memory debuggers, which prevents cluttered outupt.
+ * rgerhards, 2008-03-20
+ */
+static void
+freeAllDynMemForTermination(void)
+{
+ if(pszMainMsgQFName != NULL)
+ free(pszMainMsgQFName);
+ if(pModDir != NULL)
+ free(pModDir);
+}
+
+
+/* die() is called when the program shall end. This typically only occurs
+ * during sigterm or during the initialization.
+ * As die() is intended to shutdown rsyslogd, it is
+ * safe to call exit() here. Just make sure that die() itself is not called
+ * at inapropriate places. As a general rule of thumb, it is a bad idea to add
+ * any calls to die() in new code!
+ * rgerhards, 2005-10-24
+ */
+static void
+die(int sig)
+{
+ char buf[256];
+
+ dbgprintf("exiting on signal %d\n", sig);
+
+ /* IMPORTANT: we should close the inputs first, and THEN send our termination
+ * message. If we do it the other way around, logmsgInternal() may block on
+ * a full queue and the inputs still fill up that queue. Depending on the
+ * scheduling order, we may end up with logmsgInternal being held for a quite
+ * long time. When the inputs are terminated first, that should not happen
+ * because the queue is drained in parallel. The situation could only become
+ * an issue with extremely long running actions in a queue full environment.
+ * However, such actions are at least considered poorly written, if not
+ * outright wrong. So we do not care about this very remote problem.
+ * rgerhards, 2008-01-11
+ */
+
+ /* close the inputs */
+ dbgprintf("Terminating input threads...\n");
+ thrdTerminateAll(); /* TODO: inputs only, please */
+
+ /* and THEN send the termination log message (see long comment above) */
+ if (sig) {
+ (void) snprintf(buf, sizeof(buf) / sizeof(char),
+ " [origin software=\"rsyslogd\" " "swVersion=\"" VERSION \
+ "\" x-pid=\"%d\" x-info=\"http://www.rsyslog.com\"]" " exiting on signal %d.",
+ (int) myPid, sig);
+ errno = 0;
+ logmsgInternal(NO_ERRCODE, LOG_SYSLOG|LOG_INFO, (uchar*)buf, 0);
+ }
+
+ /* drain queue (if configured so) and stop main queue worker thread pool */
+ dbgprintf("Terminating main queue...\n");
+ queueDestruct(&pMsgQueue);
+ pMsgQueue = NULL;
+
+ /* Free ressources and close connections. This includes flushing any remaining
+ * repeated msgs.
+ */
+ dbgprintf("Terminating outputs...\n");
+ freeSelectors();
+
+ dbgprintf("all primary multi-thread sources have been terminated - now doing aux cleanup...\n");
+ /* rger 2005-02-22
+ * now clean up the in-memory structures. OK, the OS
+ * would also take care of that, but if we do it
+ * ourselfs, this makes finding memory leaks a lot
+ * easier.
+ */
+ tplDeleteAll();
+
+ remove_pid(PidFile);
+
+ /* de-init some modules */
+ modExitIminternal();
+
+ /*dbgPrintAllDebugInfo(); / * this is the last spot where this can be done - below output modules are unloaded! */
+
+ /* the following line cleans up CfSysLineHandlers that were not based on loadable
+ * modules. As such, they are not yet cleared.
+ */
+ unregCfSysLineHdlrs();
+
+ legacyOptsFree();
+
+ /* terminate the remaining classes */
+ GlobalClassExit();
+
+ /* TODO: this would also be the right place to de-init the builtin output modules. We
+ * do not currently do that, because the module interface does not allow for
+ * it. This will come some time later (it's essential with loadable modules).
+ * For the time being, this is a memory leak on exit, but as the process is
+ * terminated, we do not really bother about it.
+ * rgerhards, 2007-08-03
+ * I have added some code now, but all that mod init/de-init should be moved to
+ * init, so that modules are unloaded and reloaded on HUP to. Eventually it should go
+ * into freeSelectors() - but that needs to be seen. -- rgerhards, 2007-08-09
+ */
+ module.UnloadAndDestructAll(eMOD_LINK_ALL);
+
+ dbgprintf("Clean shutdown completed, bye\n");
+ /* dbgClassExit MUST be the last one, because it de-inits the debug system */
+ dbgClassExit();
+
+ /* free all remaining memory blocks - this is not absolutely necessary, but helps
+ * us keep memory debugger logs clean and this is in aid in developing. It doesn't
+ * cost much time, so we do it always. -- rgerhards, 2008-03-20
+ */
+ freeAllDynMemForTermination();
+ /* NO CODE HERE - feeelAllDynMemForTermination() must be the last thing before exit()! */
+ exit(0); /* "good" exit, this is the terminator function for rsyslog [die()] */
+}
+
+/*
+ * Signal handler to terminate the parent process.
+ * rgerhards, 2005-10-24: this is only called during forking of the
+ * detached syslogd. I consider this method to be safe.
+ */
+static void doexit()
+{
+ exit(0); /* "good" exit, only during child-creation */
+}
+
+
+/* set the maximum message size */
+static rsRetVal setMaxMsgSize(void __attribute__((unused)) *pVal, int iNewVal)
+{
+ return glbl.SetMaxLine(iNewVal);
+}
+
+
+/* set the action resume interval */
+static rsRetVal setActionResumeInterval(void __attribute__((unused)) *pVal, int iNewVal)
+{
+ return actionSetGlobalResumeInterval(iNewVal);
+}
+
+
+/* set the processes umask (upon configuration request) */
+static rsRetVal setUmask(void __attribute__((unused)) *pVal, int iUmask)
+{
+ umask(iUmask);
+ dbgprintf("umask set to 0%3.3o.\n", iUmask);
+
+ return RS_RET_OK;
+}
+
+
+/* helper to freeSelectors(), used with llExecFunc() to flush
+ * pending output. -- rgerhards, 2007-08-02
+ * We do not need to lock the action object here as the processing
+ * queue is already empty and no other threads are running when
+ * we call this function. -- rgerhards, 2007-12-12
+ */
+DEFFUNC_llExecFunc(freeSelectorsActions)
+{
+ action_t *pAction = (action_t*) pData;
+
+ assert(pAction != NULL);
+
+ /* flush any pending output */
+ if(pAction->f_prevcount) {
+ actionWriteToAction(pAction);
+ }
+
+ return RS_RET_OK; /* never fails ;) */
+}
+
+
+/* Close all open log files and free selector descriptor array.
+ */
+static void freeSelectors(void)
+{
+ selector_t *f;
+ selector_t *fPrev;
+
+ if(Files != NULL) {
+ dbgprintf("Freeing log structures.\n");
+
+ for(f = Files ; f != NULL ; f = f->f_next) {
+ llExecFunc(&f->llActList, freeSelectorsActions, NULL);
+ }
+
+ /* actions flushed and ready for destruction - so do that... */
+ f = Files;
+ while (f != NULL) {
+ fPrev = f;
+ f = f->f_next;
+ selectorDestruct(fPrev);
+ }
+
+ /* Reflect the deletion of the selectors linked list. */
+ Files = NULL;
+ bHaveMainQueue = 0;
+ }
+}
+
+
+/* helper to dbPrintInitInfo, to print out all actions via
+ * the llExecFunc() facility.
+ * rgerhards, 2007-08-02
+ */
+DEFFUNC_llExecFunc(dbgPrintInitInfoAction)
+{
+ DEFiRet;
+ iRet = actionDbgPrint((action_t*) pData);
+ dbgprintf("\n");
+
+ RETiRet;
+}
+
+/* print debug information as part of init(). This pretty much
+ * outputs the whole config of rsyslogd. I've moved this code
+ * out of init() to clean it somewhat up.
+ * rgerhards, 2007-07-31
+ */
+static void dbgPrintInitInfo(void)
+{
+ register selector_t *f;
+ int iSelNbr = 1;
+ int i;
+
+ dbgprintf("\nActive selectors:\n");
+ for (f = Files; f != NULL ; f = f->f_next) {
+ dbgprintf("Selector %d:\n", iSelNbr++);
+ if(f->pCSProgNameComp != NULL)
+ dbgprintf("tag: '%s'\n", rsCStrGetSzStrNoNULL(f->pCSProgNameComp));
+ if(f->eHostnameCmpMode != HN_NO_COMP)
+ dbgprintf("hostname: %s '%s'\n",
+ f->eHostnameCmpMode == HN_COMP_MATCH ?
+ "only" : "allbut",
+ rsCStrGetSzStrNoNULL(f->pCSHostnameComp));
+ if(f->f_filter_type == FILTER_PRI) {
+ for (i = 0; i <= LOG_NFACILITIES; i++)
+ if (f->f_filterData.f_pmask[i] == TABLE_NOPRI)
+ dbgprintf(" X ");
+ else
+ dbgprintf("%2X ", f->f_filterData.f_pmask[i]);
+ } else if(f->f_filter_type == FILTER_EXPR) {
+ dbgprintf("EXPRESSION-BASED Filter: can currently not be displayed");
+ } else {
+ dbgprintf("PROPERTY-BASED Filter:\n");
+ dbgprintf("\tProperty.: '%s'\n",
+ rsCStrGetSzStrNoNULL(f->f_filterData.prop.pCSPropName));
+ dbgprintf("\tOperation: ");
+ if(f->f_filterData.prop.isNegated)
+ dbgprintf("NOT ");
+ dbgprintf("'%s'\n", getFIOPName(f->f_filterData.prop.operation));
+ dbgprintf("\tValue....: '%s'\n",
+ rsCStrGetSzStrNoNULL(f->f_filterData.prop.pCSCompValue));
+ dbgprintf("\tAction...: ");
+ }
+
+ dbgprintf("\nActions:\n");
+ llExecFunc(&f->llActList, dbgPrintInitInfoAction, NULL); /* actions */
+
+ dbgprintf("\n");
+ }
+ dbgprintf("\n");
+ if(bDebugPrintTemplateList)
+ tplPrintList();
+ if(bDebugPrintModuleList)
+ module.PrintList();
+ ochPrintList();
+
+ if(bDebugPrintCfSysLineHandlerList)
+ dbgPrintCfSysLineHandlers();
+
+ dbgprintf("Messages with malicious PTR DNS Records are %sdropped.\n",
+ glbl.GetDropMalPTRMsgs() ? "" : "not ");
+
+ dbgprintf("Control characters are %sreplaced upon reception.\n",
+ bEscapeCCOnRcv? "" : "not ");
+
+ if(bEscapeCCOnRcv)
+ dbgprintf("Control character escape sequence prefix is '%c'.\n",
+ cCCEscapeChar);
+
+ dbgprintf("Main queue size %d messages.\n", iMainMsgQueueSize);
+ dbgprintf("Main queue worker threads: %d, Perists every %d updates.\n",
+ iMainMsgQueueNumWorkers, iMainMsgQPersistUpdCnt);
+ dbgprintf("Main queue timeouts: shutdown: %d, action completion shutdown: %d, enq: %d\n",
+ iMainMsgQtoQShutdown, iMainMsgQtoActShutdown, iMainMsgQtoEnq);
+ dbgprintf("Main queue watermarks: high: %d, low: %d, discard: %d, discard-severity: %d\n",
+ iMainMsgQHighWtrMark, iMainMsgQLowWtrMark, iMainMsgQDiscardMark, iMainMsgQDiscardSeverity);
+ dbgprintf("Main queue save on shutdown %d, max disk space allowed %lld\n",
+ bMainMsgQSaveOnShutdown, iMainMsgQueMaxDiskSpace);
+ /* TODO: add
+ iActionRetryCount = 0;
+ iActionRetryInterval = 30000;
+ static int iMainMsgQtoWrkShutdown = 60000;
+ static int iMainMsgQtoWrkMinMsgs = 100;
+ static int iMainMsgQbSaveOnShutdown = 1;
+ iMainMsgQueMaxDiskSpace = 0;
+ setQPROP(queueSettoWrkShutdown, "$MainMsgQueueTimeoutWorkerThreadShutdown", 5000);
+ setQPROP(queueSetiMinMsgsPerWrkr, "$MainMsgQueueWorkerThreadMinimumMessages", 100);
+ setQPROP(queueSetbSaveOnShutdown, "$MainMsgQueueSaveOnShutdown", 1);
+ */
+ dbgprintf("Work Directory: '%s'.\n", glbl.GetWorkDir());
+}
+
+
+/* Start the input modules. This function will probably undergo big changes
+ * while we implement the input module interface. For now, it does the most
+ * important thing to get at least my poor initial input modules up and
+ * running. Almost no config option is taken.
+ * rgerhards, 2007-12-14
+ */
+static rsRetVal
+startInputModules(void)
+{
+ DEFiRet;
+ modInfo_t *pMod;
+
+ /* loop through all modules and activate them (brr...) */
+ pMod = module.GetNxtType(NULL, eMOD_IN);
+ while(pMod != NULL) {
+ if((iRet = pMod->mod.im.willRun()) == RS_RET_OK) {
+ /* activate here */
+ thrdCreate(pMod->mod.im.runInput, pMod->mod.im.afterRun);
+ } else {
+ dbgprintf("module %lx will not run, iRet %d\n", (unsigned long) pMod, iRet);
+ }
+ pMod = module.GetNxtType(pMod, eMOD_IN);
+ }
+
+ ENDfunc
+ return RS_RET_OK; /* intentional: we do not care about module errors */
+}
+
+
+/* INIT -- Initialize syslogd from configuration table
+ * init() is called at initial startup AND each time syslogd is HUPed
+ * Note that if iConfigVerify is set, only the config file is verified but nothing
+ * else happens. -- rgerhards, 2008-07-28
+ */
+static rsRetVal
+init(void)
+{
+ DEFiRet;
+ rsRetVal localRet;
+ int iNbrActions;
+ int bHadConfigErr = 0;
+ char cbuf[BUFSIZ];
+ char bufStartUpMsg[512];
+ struct sigaction sigAct;
+
+ thrdTerminateAll(); /* stop all running input threads - TODO: reconsider location! */
+
+ /* initialize some static variables */
+ pDfltHostnameCmp = NULL;
+ pDfltProgNameCmp = NULL;
+ eDfltHostnameCmpMode = HN_NO_COMP;
+
+ dbgprintf("rsyslog %s - called init()\n", VERSION);
+
+ /* delete the message queue, which also flushes all messages left over */
+ if(pMsgQueue != NULL) {
+ dbgprintf("deleting main message queue\n");
+ queueDestruct(&pMsgQueue); /* delete pThis here! */
+ pMsgQueue = NULL;
+ }
+
+ /* Close all open log files and free log descriptor array. This also frees
+ * all output-modules instance data.
+ */
+ freeSelectors();
+
+ /* Unload all non-static modules */
+ dbgprintf("Unloading non-static modules.\n");
+ module.UnloadAndDestructAll(eMOD_LINK_DYNAMIC_LOADED);
+
+ dbgprintf("Clearing templates.\n");
+ tplDeleteNew();
+
+ /* re-setting values to defaults (where applicable) */
+ /* once we have loadable modules, we must re-visit this code. The reason is
+ * that config variables are not re-set, because the module is not yet loaded. On
+ * the other hand, that doesn't matter, because the module got unloaded and is then
+ * re-loaded, so the variables should be re-set via that way. And this is exactly how
+ * it works. Loadable module's variables are initialized on load, the rest here.
+ * rgerhards, 2008-04-28
+ */
+ conf.cfsysline((uchar*)"ResetConfigVariables");
+
+ conf.ReInitConf();
+
+ /* open the configuration file */
+ localRet = conf.processConfFile(ConfFile);
+ CHKiRet(conf.GetNbrActActions(&iNbrActions));
+
+ if(localRet != RS_RET_OK) {
+ errmsg.LogError(0, localRet, "CONFIG ERROR: could not interpret master config file '%s'.", ConfFile);
+ bHadConfigErr = 1;
+ } else if(iNbrActions == 0) {
+ errmsg.LogError(0, RS_RET_NO_ACTIONS, "CONFIG ERROR: there are no active actions configured. Inputs will "
+ "run, but no output whatsoever is created.");
+ bHadConfigErr = 1;
+ }
+
+ if((localRet != RS_RET_OK && localRet != RS_RET_NONFATAL_CONFIG_ERR) || iNbrActions == 0) {
+ /* rgerhards: this code is executed to set defaults when the
+ * config file could not be opened. We might think about
+ * abandoning the run in this case - but this, too, is not
+ * very clever... So we stick with what we have.
+ * We ignore any errors while doing this - we would be lost anyhow...
+ */
+ errmsg.LogError(0, NO_ERRCODE, "EMERGENCY CONFIGURATION ACTIVATED - fix rsyslog config file!");
+ selector_t *f = NULL;
+
+ /* note: we previously used _POSIY_TTY_NAME_MAX+1, but this turned out to be
+ * too low on linux... :-S -- rgerhards, 2008-07-28
+ */
+ char szTTYNameBuf[128];
+ conf.cfline((uchar*)"*.ERR\t" _PATH_CONSOLE, &f);
+ conf.cfline((uchar*)"syslog.*\t" _PATH_CONSOLE, &f);
+ conf.cfline((uchar*)"*.PANIC\t*", &f);
+ conf.cfline((uchar*)"syslog.*\troot", &f);
+ if(ttyname_r(0, szTTYNameBuf, sizeof(szTTYNameBuf)) == 0) {
+ snprintf(cbuf,sizeof(cbuf), "*.*\t%s", szTTYNameBuf);
+ conf.cfline((uchar*)cbuf, &f);
+ } else {
+ dbgprintf("error %d obtaining controlling terminal, not using that emergency rule\n", errno);
+ }
+ selectorAddList(f);
+ }
+
+ legacyOptsHook();
+
+ /* we are now done with reading the configuration. This is the right time to
+ * free some objects that were just needed for loading it. rgerhards 2005-10-19
+ */
+ if(pDfltHostnameCmp != NULL) {
+ rsCStrDestruct(&pDfltHostnameCmp);
+ }
+
+ if(pDfltProgNameCmp != NULL) {
+ rsCStrDestruct(&pDfltProgNameCmp);
+ }
+
+ /* some checks */
+ if(iMainMsgQueueNumWorkers < 1) {
+ errmsg.LogError(0, NO_ERRCODE, "$MainMsgQueueNumWorkers must be at least 1! Set to 1.\n");
+ iMainMsgQueueNumWorkers = 1;
+ }
+
+ if(MainMsgQueType == QUEUETYPE_DISK) {
+ errno = 0; /* for logerror! */
+ if(glbl.GetWorkDir() == NULL) {
+ errmsg.LogError(0, NO_ERRCODE, "No $WorkDirectory specified - can not run main message queue in 'disk' mode. "
+ "Using 'FixedArray' instead.\n");
+ MainMsgQueType = QUEUETYPE_FIXED_ARRAY;
+ }
+ if(pszMainMsgQFName == NULL) {
+ errmsg.LogError(0, NO_ERRCODE, "No $MainMsgQueueFileName specified - can not run main message queue in "
+ "'disk' mode. Using 'FixedArray' instead.\n");
+ MainMsgQueType = QUEUETYPE_FIXED_ARRAY;
+ }
+ }
+
+ /* we are done checking the config - now validate if we should actually run or not.
+ * If not, terminate. -- rgerhards, 2008-07-25
+ */
+ if(iConfigVerify) {
+ if(bHadConfigErr) {
+ /* a bit dirty, but useful... */
+ exit(1);
+ }
+ ABORT_FINALIZE(RS_RET_VALIDATION_RUN);
+ }
+
+ /* switch the message object to threaded operation, if necessary */
+ if(MainMsgQueType == QUEUETYPE_DIRECT || iMainMsgQueueNumWorkers > 1) {
+ MsgEnableThreadSafety();
+ }
+
+ /* create message queue */
+ CHKiRet_Hdlr(queueConstruct(&pMsgQueue, MainMsgQueType, iMainMsgQueueNumWorkers, iMainMsgQueueSize, msgConsumer)) {
+ /* no queue is fatal, we need to give up in that case... */
+ fprintf(stderr, "fatal error %d: could not create message queue - rsyslogd can not run!\n", iRet);
+ exit(1);
+ }
+ /* name our main queue object (it's not fatal if it fails...) */
+ obj.SetName((obj_t*) pMsgQueue, (uchar*) "main queue");
+
+ /* ... set some properties ... */
+# define setQPROP(func, directive, data) \
+ CHKiRet_Hdlr(func(pMsgQueue, data)) { \
+ errmsg.LogError(0, NO_ERRCODE, "Invalid " #directive ", error %d. Ignored, running with default setting", iRet); \
+ }
+# define setQPROPstr(func, directive, data) \
+ CHKiRet_Hdlr(func(pMsgQueue, data, (data == NULL)? 0 : strlen((char*) data))) { \
+ errmsg.LogError(0, NO_ERRCODE, "Invalid " #directive ", error %d. Ignored, running with default setting", iRet); \
+ }
+
+ setQPROP(queueSetMaxFileSize, "$MainMsgQueueFileSize", iMainMsgQueMaxFileSize);
+ setQPROP(queueSetsizeOnDiskMax, "$MainMsgQueueMaxDiskSpace", iMainMsgQueMaxDiskSpace);
+ setQPROPstr(queueSetFilePrefix, "$MainMsgQueueFileName", pszMainMsgQFName);
+ setQPROP(queueSetiPersistUpdCnt, "$MainMsgQueueCheckpointInterval", iMainMsgQPersistUpdCnt);
+ setQPROP(queueSettoQShutdown, "$MainMsgQueueTimeoutShutdown", iMainMsgQtoQShutdown );
+ setQPROP(queueSettoActShutdown, "$MainMsgQueueTimeoutActionCompletion", iMainMsgQtoActShutdown);
+ setQPROP(queueSettoWrkShutdown, "$MainMsgQueueWorkerTimeoutThreadShutdown", iMainMsgQtoWrkShutdown);
+ setQPROP(queueSettoEnq, "$MainMsgQueueTimeoutEnqueue", iMainMsgQtoEnq);
+ setQPROP(queueSetiHighWtrMrk, "$MainMsgQueueHighWaterMark", iMainMsgQHighWtrMark);
+ setQPROP(queueSetiLowWtrMrk, "$MainMsgQueueLowWaterMark", iMainMsgQLowWtrMark);
+ setQPROP(queueSetiDiscardMrk, "$MainMsgQueueDiscardMark", iMainMsgQDiscardMark);
+ setQPROP(queueSetiDiscardSeverity, "$MainMsgQueueDiscardSeverity", iMainMsgQDiscardSeverity);
+ setQPROP(queueSetiMinMsgsPerWrkr, "$MainMsgQueueWorkerThreadMinimumMessages", iMainMsgQWrkMinMsgs);
+ setQPROP(queueSetbSaveOnShutdown, "$MainMsgQueueSaveOnShutdown", bMainMsgQSaveOnShutdown);
+ setQPROP(queueSetiDeqSlowdown, "$MainMsgQueueDequeueSlowdown", iMainMsgQDeqSlowdown);
+ setQPROP(queueSetiDeqtWinFromHr, "$MainMsgQueueDequeueTimeBegin", iMainMsgQueueDeqtWinFromHr);
+ setQPROP(queueSetiDeqtWinToHr, "$MainMsgQueueDequeueTimeEnd", iMainMsgQueueDeqtWinToHr);
+
+# undef setQPROP
+# undef setQPROPstr
+
+ /* ... and finally start the queue! */
+ CHKiRet_Hdlr(queueStart(pMsgQueue)) {
+ /* no queue is fatal, we need to give up in that case... */
+ fprintf(stderr, "fatal error %d: could not start message queue - rsyslogd can not run!\n", iRet);
+ exit(1);
+ }
+
+ bHaveMainQueue = (MainMsgQueType == QUEUETYPE_DIRECT) ? 0 : 1;
+ dbgprintf("Main processing queue is initialized and running\n");
+
+ /* the output part and the queue is now ready to run. So it is a good time
+ * to start the inputs. Please note that the net code above should be
+ * shuffled to down here once we have everything in input modules.
+ * rgerhards, 2007-12-14
+ */
+ startInputModules();
+
+ if(Debug) {
+ dbgPrintInitInfo();
+ }
+
+ /* we now generate the startup message. It now includes everything to
+ * identify this instance. -- rgerhards, 2005-08-17
+ */
+ snprintf(bufStartUpMsg, sizeof(bufStartUpMsg)/sizeof(char),
+ " [origin software=\"rsyslogd\" " "swVersion=\"" VERSION \
+ "\" x-pid=\"%d\" x-info=\"http://www.rsyslog.com\"] (re)start",
+ (int) myPid);
+ logmsgInternal(NO_ERRCODE, LOG_SYSLOG|LOG_INFO, (uchar*)bufStartUpMsg, 0);
+
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+ sigAct.sa_handler = sighup_handler;
+ sigaction(SIGHUP, &sigAct, NULL);
+
+ dbgprintf(" (re)started.\n");
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* add a completely-processed selector (after config line parsing) to
+ * the linked list of selectors. We now need to check
+ * if it has any actions associated and, if so, link it to the linked
+ * list. If it has nothing associated with it, we can simply discard
+ * it.
+ * We have one special case during initialization: then, the current
+ * selector is NULL, which means we do not need to care about it at
+ * all. -- rgerhards, 2007-08-01
+ */
+rsRetVal
+selectorAddList(selector_t *f)
+{
+ DEFiRet;
+ int iActionCnt;
+
+ static selector_t *nextp = NULL; /* TODO: make this go away (see comment below) */
+
+ if(f != NULL) {
+ CHKiRet(llGetNumElts(&f->llActList, &iActionCnt));
+ if(iActionCnt == 0) {
+ errmsg.LogError(0, NO_ERRCODE, "warning: selector line without actions will be discarded");
+ selectorDestruct(f);
+ } else {
+ /* successfully created an entry */
+ dbgprintf("selector line successfully processed\n");
+ /* TODO: we should use the linked list class for the selector list, else we need to add globals
+ * ... well nextp could be added temporarily...
+ * Thanks to varmojfekoj for having the idea to just use "Files" to make this
+ * code work. I had actually forgotten to fix the code here before moving to 1.18.0.
+ * And, of course, I also did not migrate the selector_t structure to the linked list class.
+ * However, that should still be one of the very next things to happen.
+ * rgerhards, 2007-08-06
+ */
+ if(Files == NULL) {
+ Files = f;
+ } else {
+ nextp->f_next = f;
+ }
+ nextp = f;
+ }
+ }
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* set the main message queue mode
+ * rgerhards, 2008-01-03
+ */
+static rsRetVal setMainMsgQueType(void __attribute__((unused)) *pVal, uchar *pszType)
+{
+ DEFiRet;
+
+ if (!strcasecmp((char *) pszType, "fixedarray")) {
+ MainMsgQueType = QUEUETYPE_FIXED_ARRAY;
+ dbgprintf("main message queue type set to FIXED_ARRAY\n");
+ } else if (!strcasecmp((char *) pszType, "linkedlist")) {
+ MainMsgQueType = QUEUETYPE_LINKEDLIST;
+ dbgprintf("main message queue type set to LINKEDLIST\n");
+ } else if (!strcasecmp((char *) pszType, "disk")) {
+ MainMsgQueType = QUEUETYPE_DISK;
+ dbgprintf("main message queue type set to DISK\n");
+ } else if (!strcasecmp((char *) pszType, "direct")) {
+ MainMsgQueType = QUEUETYPE_DIRECT;
+ dbgprintf("main message queue type set to DIRECT (no queueing at all)\n");
+ } else {
+ errmsg.LogError(0, RS_RET_INVALID_PARAMS, "unknown mainmessagequeuetype parameter: %s", (char *) pszType);
+ iRet = RS_RET_INVALID_PARAMS;
+ }
+ free(pszType); /* no longer needed */
+
+ RETiRet;
+}
+
+
+/*
+ * The following function is resposible for handling a SIGHUP signal. Since
+ * we are now doing mallocs/free as part of init we had better not being
+ * doing this during a signal handler. Instead this function simply sets
+ * a flag variable which will tell the main loop to go through a restart.
+ */
+void sighup_handler()
+{
+ struct sigaction sigAct;
+
+ restart = 1;
+
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+ sigAct.sa_handler = sighup_handler;
+ sigaction(SIGHUP, &sigAct, NULL);
+
+ return;
+}
+
+
+/* this function pulls all internal messages from the buffer
+ * and puts them into the processing engine.
+ * We can only do limited error handling, as this would not
+ * really help us. TODO: add error messages?
+ * rgerhards, 2007-08-03
+ */
+static void processImInternal(void)
+{
+ int iPri;
+ int iFlags;
+ msg_t *pMsg;
+
+ while(iminternalRemoveMsg(&iPri, &pMsg, &iFlags) == RS_RET_OK) {
+ logmsg(pMsg, iFlags);
+ }
+}
+
+
+/* This is the main processing loop. It is called after successful initialization.
+ * When it returns, the syslogd terminates.
+ * Its sole function is to provide some housekeeping things. The real work is done
+ * by the other threads spawned.
+ */
+static void
+mainloop(void)
+{
+ struct timeval tvSelectTimeout;
+
+ BEGINfunc
+ /* first check if we have any internal messages queued and spit them out. We used
+ * to do that on any loop iteration, but that is no longer necessry. The reason
+ * is that once we reach this point here, we always run on multiple threads and
+ * thus the main queue is properly initialized. -- rgerhards, 2008-06-09
+ */
+ processImInternal();
+
+ while(!bFinished){
+ /* this is now just a wait - please note that we do use a near-"eternal"
+ * timeout of 1 day if we do not have repeated message reduction turned on
+ * (which it is not by default). This enables us to help safe the environment
+ * by not unnecessarily awaking rsyslog on a regular tick (just think
+ * powertop, for example). In that case, we primarily wait for a signal,
+ * but a once-a-day wakeup should be quite acceptable. -- rgerhards, 2008-06-09
+ */
+ tvSelectTimeout.tv_sec = (bReduceRepeatMsgs == 1) ? TIMERINTVL : 86400 /*1 day*/;
+ tvSelectTimeout.tv_usec = 0;
+ select(1, NULL, NULL, NULL, &tvSelectTimeout);
+ if(bFinished)
+ break; /* exit as quickly as possible - see long comment below */
+
+ /* If we received a HUP signal, we call doFlushRptdMsgs() a bit early. This
+ * doesn't matter, because doFlushRptdMsgs() checks timestamps. What may happen,
+ * however, is that the too-early call may lead to a bit too-late output
+ * of "last message repeated n times" messages. But that is quite acceptable.
+ * rgerhards, 2007-12-21
+ * ... and just to explain, we flush here because that is exactly what the mainloop
+ * shall do - provide a periodic interval in which not-yet-flushed messages will
+ * be flushed. Be careful, there is a potential race condition: doFlushRptdMsgs()
+ * needs to aquire a lock on the action objects. If, however, long-running consumers
+ * cause the main queue worker threads to lock them for a long time, we may receive
+ * a starvation condition, resulting in the mainloop being held on lock for an extended
+ * period of time. That, in turn, could lead to unresponsiveness to termination
+ * requests. It is especially important that the bFinished flag is checked before
+ * doFlushRptdMsgs() is called (I know because I ran into that situation). I am
+ * not yet sure if the remaining probability window of a termination-related
+ * problem is large enough to justify changing the code - I would consider it
+ * extremely unlikely that the problem ever occurs in practice. Fixing it would
+ * require not only a lot of effort but would cost considerable performance. So
+ * for the time being, I think the remaining risk can be accepted.
+ * rgerhards, 2008-01-10
+ */
+ if(bReduceRepeatMsgs == 1)
+ doFlushRptdMsgs();
+
+ if(restart) {
+ dbgprintf("\nReceived SIGHUP, reloading rsyslogd.\n");
+ /* main queue is stopped as part of init() */
+ init();
+ restart = 0;
+ continue;
+ }
+ }
+ ENDfunc
+}
+
+/* If user is not root, prints warnings or even exits
+ * TODO: check all dynafiles for write permission
+ * ... but it is probably better to wait here until we have
+ * a module interface - rgerhards, 2007-07-23
+ */
+static void checkPermissions()
+{
+#if 0
+ /* TODO: this function must either be redone or removed - now with the input modules,
+ * there is no such simple check we can do. What we can check, however, is if there is
+ * any input module active and terminate, if not. -- rgerhards, 2007-12-26
+ */
+ /* we are not root */
+ if (geteuid() != 0)
+ {
+ fputs("WARNING: Local messages will not be logged! If you want to log them, run rsyslog as root.\n",stderr);
+#ifdef SYSLOG_INET
+ /* udp enabled and port number less than or equal to 1024 */
+ if ( AcceptRemote && (atoi(LogPort) <= 1024) )
+ fprintf(stderr, "WARNING: Will not listen on UDP port %s. Use port number higher than 1024 or run rsyslog as root!\n", LogPort);
+
+ /* tcp enabled and port number less or equal to 1024 */
+ if( bEnableTCP && (atoi(TCPLstnPort) <= 1024) )
+ fprintf(stderr, "WARNING: Will not listen on TCP port %s. Use port number higher than 1024 or run rsyslog as root!\n", TCPLstnPort);
+
+ /* Neither explicit high UDP port nor explicit high TCP port.
+ * It is useless to run anymore */
+ if( !(AcceptRemote && (atoi(LogPort) > 1024)) && !( bEnableTCP && (atoi(TCPLstnPort) > 1024)) )
+ {
+#endif
+ fprintf(stderr, "ERROR: Nothing to log, no reason to run. Please run rsyslog as root.\n");
+ exit(EXIT_FAILURE);
+#ifdef SYSLOG_INET
+ }
+#endif
+ }
+#endif
+}
+
+
+/* load build-in modules
+ * very first version begun on 2007-07-23 by rgerhards
+ */
+static rsRetVal loadBuildInModules(void)
+{
+ DEFiRet;
+
+ if((iRet = module.doModInit(modInitFile, (uchar*) "builtin-file", NULL)) != RS_RET_OK) {
+ RETiRet;
+ }
+#ifdef SYSLOG_INET
+ if((iRet = module.doModInit(modInitFwd, (uchar*) "builtin-fwd", NULL)) != RS_RET_OK) {
+ RETiRet;
+ }
+#endif
+ if((iRet = module.doModInit(modInitShell, (uchar*) "builtin-shell", NULL)) != RS_RET_OK) {
+ RETiRet;
+ }
+ if((iRet = module.doModInit(modInitDiscard, (uchar*) "builtin-discard", NULL)) != RS_RET_OK) {
+ RETiRet;
+ }
+
+ /* dirty, but this must be for the time being: the usrmsg module must always be
+ * loaded as last module. This is because it processes any time of action selector.
+ * If we load it before other modules, these others will never have a chance of
+ * working with the config file. We may change that implementation so that a user name
+ * must start with an alnum, that would definitely help (but would it break backwards
+ * compatibility?). * rgerhards, 2007-07-23
+ * User names now must begin with:
+ * [a-zA-Z0-9_.]
+ */
+ if((iRet = module.doModInit(modInitUsrMsg, (uchar*) "builtin-usrmsg", NULL)) != RS_RET_OK)
+ RETiRet;
+
+ /* ok, initialization of the command handler probably does not 100% belong right in
+ * this space here. However, with the current design, this is actually quite a good
+ * place to put it. We might decide to shuffle it around later, but for the time
+ * being, the code has found its home here. A not-just-sideeffect of this decision
+ * is that rsyslog will terminate if we can not register our built-in config commands.
+ * This, I think, is the right thing to do. -- rgerhards, 2007-07-31
+ */
+ CHKiRet(regCfSysLineHdlr((uchar *)"actionresumeretrycount", 0, eCmdHdlrInt, NULL, &glbliActionResumeRetryCount, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuefilename", 0, eCmdHdlrGetWord, NULL, &pszMainMsgQFName, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuesize", 0, eCmdHdlrInt, NULL, &iMainMsgQueueSize, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuehighwatermark", 0, eCmdHdlrInt, NULL, &iMainMsgQHighWtrMark, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuelowwatermark", 0, eCmdHdlrInt, NULL, &iMainMsgQLowWtrMark, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuediscardmark", 0, eCmdHdlrInt, NULL, &iMainMsgQDiscardMark, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuediscardseverity", 0, eCmdHdlrSeverity, NULL, &iMainMsgQDiscardSeverity, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuecheckpointinterval", 0, eCmdHdlrInt, NULL, &iMainMsgQPersistUpdCnt, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuetype", 0, eCmdHdlrGetWord, setMainMsgQueType, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueueworkerthreads", 0, eCmdHdlrInt, NULL, &iMainMsgQueueNumWorkers, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuetimeoutshutdown", 0, eCmdHdlrInt, NULL, &iMainMsgQtoQShutdown, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuetimeoutactioncompletion", 0, eCmdHdlrInt, NULL, &iMainMsgQtoActShutdown, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuetimeoutenqueue", 0, eCmdHdlrInt, NULL, &iMainMsgQtoEnq, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueueworkertimeoutthreadshutdown", 0, eCmdHdlrInt, NULL, &iMainMsgQtoWrkShutdown, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuedequeueslowdown", 0, eCmdHdlrInt, NULL, &iMainMsgQDeqSlowdown, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueueworkerthreadminimummessages", 0, eCmdHdlrInt, NULL, &iMainMsgQWrkMinMsgs, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuemaxfilesize", 0, eCmdHdlrSize, NULL, &iMainMsgQueMaxFileSize, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuemaxdiskspace", 0, eCmdHdlrSize, NULL, &iMainMsgQueMaxDiskSpace, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuesaveonshutdown", 0, eCmdHdlrBinary, NULL, &bMainMsgQSaveOnShutdown, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuedequeuetimebegin", 0, eCmdHdlrInt, NULL, &iMainMsgQueueDeqtWinFromHr, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"mainmsgqueuedequeuetimeend", 0, eCmdHdlrInt, NULL, &iMainMsgQueueDeqtWinToHr, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"repeatedmsgreduction", 0, eCmdHdlrBinary, NULL, &bReduceRepeatMsgs, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"actionexeconlywhenpreviousissuspended", 0, eCmdHdlrBinary, NULL, &bActExecWhenPrevSusp, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"actionexeconlyonceeveryinterval", 0, eCmdHdlrInt, NULL, &iActExecOnceInterval, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"actionresumeinterval", 0, eCmdHdlrInt, setActionResumeInterval, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"controlcharacterescapeprefix", 0, eCmdHdlrGetChar, NULL, &cCCEscapeChar, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"escapecontrolcharactersonreceive", 0, eCmdHdlrBinary, NULL, &bEscapeCCOnRcv, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"droptrailinglfonreception", 0, eCmdHdlrBinary, NULL, &bDropTrailingLF, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"template", 0, eCmdHdlrCustomHandler, conf.doNameLine, (void*)DIR_TEMPLATE, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"outchannel", 0, eCmdHdlrCustomHandler, conf.doNameLine, (void*)DIR_OUTCHANNEL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"allowedsender", 0, eCmdHdlrCustomHandler, conf.doNameLine, (void*)DIR_ALLOWEDSENDER, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"modload", 0, eCmdHdlrCustomHandler, conf.doModLoad, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"includeconfig", 0, eCmdHdlrCustomHandler, conf.doIncludeLine, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"umask", 0, eCmdHdlrFileCreateMode, setUmask, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"debugprinttemplatelist", 0, eCmdHdlrBinary, NULL, &bDebugPrintTemplateList, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"debugprintmodulelist", 0, eCmdHdlrBinary, NULL, &bDebugPrintModuleList, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"debugprintcfsyslinehandlerlist", 0, eCmdHdlrBinary,
+ NULL, &bDebugPrintCfSysLineHandlerList, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"moddir", 0, eCmdHdlrGetWord, NULL, &pModDir, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"resetconfigvariables", 1, eCmdHdlrCustomHandler, resetConfigVariables, NULL, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"errormessagestostderr", 0, eCmdHdlrBinary, NULL, &bErrMsgToStderr, NULL));
+ CHKiRet(regCfSysLineHdlr((uchar *)"maxmessagesize", 0, eCmdHdlrSize, setMaxMsgSize, NULL, NULL));
+
+ /* now add other modules handlers (we should work on that to be able to do it in ClassInit(), but so far
+ * that is not possible). -- rgerhards, 2008-01-28
+ */
+ CHKiRet(actionAddCfSysLineHdrl());
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* print version and compile-time setting information.
+ */
+static void printVersion(void)
+{
+ printf("rsyslogd %s, ", VERSION);
+ printf("compiled with:\n");
+#ifdef FEATURE_REGEXP
+ printf("\tFEATURE_REGEXP:\t\t\t\tYes\n");
+#else
+ printf("\tFEATURE_REGEXP:\t\t\t\tNo\n");
+#endif
+#ifndef NOLARGEFILE
+ printf("\tFEATURE_LARGEFILE:\t\t\tYes\n");
+#else
+ printf("\tFEATURE_LARGEFILE:\t\t\tNo\n");
+#endif
+#ifdef USE_NETZIP
+ printf("\tFEATURE_NETZIP (message compression):\tYes\n");
+#else
+ printf("\tFEATURE_NETZIP (message compression):\tNo\n");
+#endif
+#if defined(SYSLOG_INET) && defined(USE_GSSAPI)
+ printf("\tGSSAPI Kerberos 5 support:\t\tYes\n");
+#else
+ printf("\tGSSAPI Kerberos 5 support:\t\tNo\n");
+#endif
+#ifndef NDEBUG
+ printf("\tFEATURE_DEBUG (debug build, slow code):\tYes\n");
+#else
+ printf("\tFEATURE_DEBUG (debug build, slow code):\tNo\n");
+#endif
+#ifdef HAVE_ATOMIC_BUILTINS
+ printf("\tAtomic operations supported:\t\tYes\n");
+#else
+ printf("\tAtomic operations supported:\t\tNo\n");
+#endif
+#ifdef RTINST
+ printf("\tRuntime Instrumentation (slow code):\tYes\n");
+#else
+ printf("\tRuntime Instrumentation (slow code):\tNo\n");
+#endif
+ printf("\nSee http://www.rsyslog.com for more information.\n");
+}
+
+
+/* This function is called after initial initalization. It is used to
+ * move code out of the too-long main() function.
+ * rgerhards, 2007-10-17
+ */
+static rsRetVal mainThread()
+{
+ DEFiRet;
+ uchar *pTmp;
+
+ /* Note: signals MUST be processed by the thread this code is running in. The reason
+ * is that we need to interrupt the select() system call. -- rgerhards, 2007-10-17
+ */
+
+ /* initialize the build-in templates */
+ pTmp = template_DebugFormat;
+ tplAddLine("RSYSLOG_DebugFormat", &pTmp);
+ pTmp = template_SyslogProtocol23Format;
+ tplAddLine("RSYSLOG_SyslogProtocol23Format", &pTmp);
+ pTmp = template_FileFormat; /* new format for files with high-precision stamp */
+ tplAddLine("RSYSLOG_FileFormat", &pTmp);
+ pTmp = template_TraditionalFileFormat;
+ tplAddLine("RSYSLOG_TraditionalFileFormat", &pTmp);
+ pTmp = template_WallFmt;
+ tplAddLine(" WallFmt", &pTmp);
+ pTmp = template_ForwardFormat;
+ tplAddLine("RSYSLOG_ForwardFormat", &pTmp);
+ pTmp = template_TraditionalForwardFormat;
+ tplAddLine("RSYSLOG_TraditionalForwardFormat", &pTmp);
+ pTmp = template_StdUsrMsgFmt;
+ tplAddLine(" StdUsrMsgFmt", &pTmp);
+ pTmp = template_StdDBFmt;
+ tplAddLine(" StdDBFmt", &pTmp);
+ pTmp = template_StdPgSQLFmt;
+ tplLastStaticInit(tplAddLine(" StdPgSQLFmt", &pTmp));
+
+ CHKiRet(init());
+
+ if(Debug && debugging_on) {
+ dbgprintf("Debugging enabled, SIGUSR1 to turn off debugging.\n");
+ }
+ /* Send a signal to the parent so it can terminate.
+ */
+ if (myPid != ppid)
+ kill (ppid, SIGTERM);
+
+ /* END OF INTIALIZATION
+ * ... but keep in mind that we might do a restart and thus init() might
+ * be called again. If that happens, we must shut down the worker thread,
+ * do the init() and then restart things.
+ * rgerhards, 2005-10-24
+ */
+ dbgprintf("initialization completed, transitioning to regular run mode\n");
+
+ mainloop();
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* Method to initialize all global classes and use the objects that we need.
+ * rgerhards, 2008-01-04
+ * rgerhards, 2008-04-16: the actual initialization is now carried out by the runtime
+ */
+static rsRetVal
+InitGlobalClasses(void)
+{
+ DEFiRet;
+ char *pErrObj; /* tells us which object failed if that happens (useful for troubleshooting!) */
+
+ /* Intialize the runtime system */
+ pErrObj = "rsyslog runtime"; /* set in case the runtime errors before setting an object */
+ CHKiRet(rsrtInit(&pErrObj, &obj));
+ CHKiRet(rsrtSetErrLogger(submitErrMsg)); /* set out error handler */
+
+ /* Now tell the system which classes we need ourselfs */
+ pErrObj = "glbl";
+ CHKiRet(objUse(glbl, CORE_COMPONENT));
+ pErrObj = "errmsg";
+ CHKiRet(objUse(errmsg, CORE_COMPONENT));
+ pErrObj = "module";
+ CHKiRet(objUse(module, CORE_COMPONENT));
+ pErrObj = "var";
+ CHKiRet(objUse(var, CORE_COMPONENT));
+ pErrObj = "datetime";
+ CHKiRet(objUse(datetime, CORE_COMPONENT));
+ pErrObj = "vm";
+ CHKiRet(objUse(vm, CORE_COMPONENT));
+ pErrObj = "expr";
+ CHKiRet(objUse(expr, CORE_COMPONENT));
+ pErrObj = "conf";
+ CHKiRet(objUse(conf, CORE_COMPONENT));
+
+ /* intialize some dummy classes that are not part of the runtime */
+ pErrObj = "action";
+ CHKiRet(actionClassInit());
+ pErrObj = "template";
+ CHKiRet(templateInit());
+
+ /* TODO: the dependency on net shall go away! -- rgerhards, 2008-03-07 */
+ pErrObj = "net";
+ CHKiRet(objUse(net, LM_NET_FILENAME));
+
+finalize_it:
+ if(iRet != RS_RET_OK) {
+ /* we know we are inside the init sequence, so we can safely emit
+ * messages to stderr. -- rgerhards, 2008-04-02
+ */
+ fprintf(stderr, "Error during class init for object '%s' - failing...\n", pErrObj);
+ }
+
+ RETiRet;
+}
+
+
+/* Method to exit all global classes. We do not do any error checking here,
+ * because that wouldn't help us at all. So better try to deinit blindly
+ * as much as succeeds (which usually means everything will). We just must
+ * be careful to do the de-init in the opposite order of the init, because
+ * of the dependencies. However, its not as important this time, because
+ * we have reference counting.
+ * rgerhards, 2008-03-10
+ */
+static rsRetVal
+GlobalClassExit(void)
+{
+ DEFiRet;
+
+ /* first, release everything we used ourself */
+ objRelease(net, LM_NET_FILENAME);/* TODO: the dependency on net shall go away! -- rgerhards, 2008-03-07 */
+ objRelease(conf, CORE_COMPONENT);
+ objRelease(expr, CORE_COMPONENT);
+ objRelease(vm, CORE_COMPONENT);
+ objRelease(var, CORE_COMPONENT);
+ objRelease(datetime, CORE_COMPONENT);
+
+ /* TODO: implement the rest of the deinit */
+#if 0
+ CHKiRet(datetimeClassInit(NULL));
+ CHKiRet(msgClassInit(NULL));
+ CHKiRet(strmClassInit(NULL));
+ CHKiRet(wtiClassInit(NULL));
+ CHKiRet(wtpClassInit(NULL));
+ CHKiRet(queueClassInit(NULL));
+ CHKiRet(vmstkClassInit(NULL));
+ CHKiRet(sysvarClassInit(NULL));
+ CHKiRet(vmClassInit(NULL));
+ CHKiRet(vmopClassInit(NULL));
+ CHKiRet(vmprgClassInit(NULL));
+ CHKiRet(ctok_tokenClassInit(NULL));
+ CHKiRet(ctokClassInit(NULL));
+ CHKiRet(exprClassInit(NULL));
+
+ /* dummy "classes" */
+ CHKiRet(actionClassInit());
+ CHKiRet(templateInit());
+#endif
+ /* dummy "classes */
+ strExit();
+
+#if 0
+ CHKiRet(objGetObjInterface(&obj)); /* this provides the root pointer for all other queries */
+ /* the following classes were intialized by objClassInit() */
+ CHKiRet(objUse(errmsg, CORE_COMPONENT));
+ CHKiRet(objUse(module, CORE_COMPONENT));
+#endif
+ rsrtExit(); /* *THIS* *MUST/SHOULD?* always be the first class initilizer being called (except debug)! */
+
+ RETiRet;
+}
+
+
+/* some support for command line option parsing. Any non-trivial options must be
+ * buffered until the complete command line has been parsed. This is necessary to
+ * prevent dependencies between the options. That, in turn, means we need to have
+ * something that is capable of buffering options and there values. The follwing
+ * functions handle that.
+ * rgerhards, 2008-04-04
+ */
+typedef struct bufOpt {
+ struct bufOpt *pNext;
+ char optchar;
+ char *arg;
+} bufOpt_t;
+static bufOpt_t *bufOptRoot = NULL;
+static bufOpt_t *bufOptLast = NULL;
+
+/* add option buffer */
+static rsRetVal
+bufOptAdd(char opt, char *arg)
+{
+ DEFiRet;
+ bufOpt_t *pBuf;
+
+ if((pBuf = malloc(sizeof(bufOpt_t))) == NULL)
+ ABORT_FINALIZE(RS_RET_OUT_OF_MEMORY);
+
+ pBuf->optchar = opt;
+ pBuf->arg = arg;
+ pBuf->pNext = NULL;
+
+ if(bufOptLast == NULL) {
+ bufOptRoot = pBuf; /* then there is also no root! */
+ } else {
+ bufOptLast->pNext = pBuf;
+ }
+ bufOptLast = pBuf;
+
+finalize_it:
+ RETiRet;
+}
+
+
+
+/* remove option buffer from top of list, return values and destruct buffer itself.
+ * returns RS_RET_END_OF_LINKEDLIST when no more options are present.
+ * (we use int *opt instead of char *opt to keep consistent with getopt())
+ */
+static rsRetVal
+bufOptRemove(int *opt, char **arg)
+{
+ DEFiRet;
+ bufOpt_t *pBuf;
+
+ if(bufOptRoot == NULL)
+ ABORT_FINALIZE(RS_RET_END_OF_LINKEDLIST);
+ pBuf = bufOptRoot;
+
+ *opt = pBuf->optchar;
+ *arg = pBuf->arg;
+
+ bufOptRoot = pBuf->pNext;
+ free(pBuf);
+
+finalize_it:
+ RETiRet;
+}
+
+
+/* global initialization, to be done only once and before the mainloop is started.
+ * rgerhards, 2008-07-28 (extracted from realMain())
+ */
+static rsRetVal
+doGlblProcessInit(void)
+{
+ struct sigaction sigAct;
+ int num_fds;
+ int i;
+ DEFiRet;
+
+ checkPermissions();
+ thrdInit();
+
+ if( !(Debug || NoFork) )
+ {
+ dbgprintf("Checking pidfile.\n");
+ if (!check_pid(PidFile))
+ {
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+ sigAct.sa_handler = doexit;
+ sigaction(SIGTERM, &sigAct, NULL);
+
+ if (fork()) {
+ /* Parent process
+ */
+ sleep(300);
+ /* Not reached unless something major went wrong. 5
+ * minutes should be a fair amount of time to wait.
+ * Please note that this procedure is important since
+ * the father must not exit before syslogd isn't
+ * initialized or the klogd won't be able to flush its
+ * logs. -Joey
+ */
+ exit(1); /* "good" exit - after forking, not diasabling anything */
+ }
+ num_fds = getdtablesize();
+ close(0);
+ /* we keep stdout and stderr open in case we have to emit something */
+ for (i = 3; i < num_fds; i++)
+ (void) close(i);
+ untty();
+ }
+ else
+ {
+ fputs(" Already running.\n", stderr);
+ exit(1); /* "good" exit, done if syslogd is already running */
+ }
+ } else {
+ debugging_on = 1;
+ }
+
+ /* tuck my process id away */
+ dbgprintf("Writing pidfile %s.\n", PidFile);
+ if (!check_pid(PidFile))
+ {
+ if (!write_pid(PidFile))
+ {
+ fputs("Can't write pid.\n", stderr);
+ exit(1); /* exit during startup - questionable */
+ }
+ }
+ else
+ {
+ fputs("Pidfile (and pid) already exist.\n", stderr);
+ exit(1); /* exit during startup - questionable */
+ }
+ myPid = getpid(); /* save our pid for further testing (also used for messages) */
+
+ memset(&sigAct, 0, sizeof (sigAct));
+ sigemptyset(&sigAct.sa_mask);
+
+ sigAct.sa_handler = sigsegvHdlr;
+ sigaction(SIGSEGV, &sigAct, NULL);
+ sigAct.sa_handler = sigsegvHdlr;
+ sigaction(SIGABRT, &sigAct, NULL);
+ sigAct.sa_handler = doDie;
+ sigaction(SIGTERM, &sigAct, NULL);
+ sigAct.sa_handler = Debug ? doDie : SIG_IGN;
+ sigaction(SIGINT, &sigAct, NULL);
+ sigaction(SIGQUIT, &sigAct, NULL);
+ sigAct.sa_handler = reapchild;
+ sigaction(SIGCHLD, &sigAct, NULL);
+ sigAct.sa_handler = Debug ? debug_switch : SIG_IGN;
+ sigaction(SIGUSR1, &sigAct, NULL);
+ sigAct.sa_handler = SIG_IGN;
+ sigaction(SIGPIPE, &sigAct, NULL);
+ sigaction(SIGXFSZ, &sigAct, NULL); /* do not abort if 2gig file limit is hit */
+
+ RETiRet;
+}
+
+
+/* This is the main entry point into rsyslogd. Over time, we should try to
+ * modularize it a bit more...
+ */
+int realMain(int argc, char **argv)
+{
+ DEFiRet;
+
+ register uchar *p;
+ int ch;
+ struct hostent *hent;
+ extern int optind;
+ extern char *optarg;
+ int bEOptionWasGiven = 0;
+ int bImUxSockLoaded = 0; /* already generated a $ModLoad imuxsock? */
+ int iHelperUOpt;
+ int bChDirRoot = 1; /* change the current working directory to "/"? */
+ char *arg; /* for command line option processing */
+ uchar legacyConfLine[80];
+ uchar *LocalHostName;
+ uchar *LocalDomain;
+
+ /* first, parse the command line options. We do not carry out any actual work, just
+ * see what we should do. This relieves us from certain anomalies and we can process
+ * the parameters down below in the correct order. For example, we must know the
+ * value of -M before we can do the init, but at the same time we need to have
+ * the base classes init before we can process most of the options. Now, with the
+ * split of functionality, this is no longer a problem. Thanks to varmofekoj for
+ * suggesting this algo.
+ * Note: where we just need to set some flags and can do so without knowledge
+ * of other options, we do this during the inital option processing. With later
+ * versions (if a dependency on -c option is introduced), we must move that code
+ * to other places, but I think it is quite appropriate and saves code to do this
+ * only when actually neeeded.
+ * rgerhards, 2008-04-04
+ */
+ while((ch = getopt(argc, argv, "46a:Ac:def:g:hi:l:m:M:nN:op:qQr::s:t:u:vwx")) != EOF) {
+ switch((char)ch) {
+ case '4':
+ case '6':
+ case 'A':
+ case 'a':
+ case 'f': /* configuration file */
+ case 'h':
+ case 'i': /* pid file name */
+ case 'l':
+ case 'm': /* mark interval */
+ case 'n': /* don't fork */
+ case 'N': /* enable config verify mode */
+ case 'o':
+ case 'p':
+ case 'q': /* add hostname if DNS resolving has failed */
+ case 'Q': /* dont resolve hostnames in ACL to IPs */
+ case 's':
+ case 'u': /* misc user settings */
+ case 'w': /* disable disallowed host warnings */
+ case 'x': /* disable dns for remote messages */
+ CHKiRet(bufOptAdd(ch, optarg));
+ break;
+ case 'c': /* compatibility mode */
+ iCompatibilityMode = atoi(optarg);
+ break;
+ case 'd': /* debug - must be handled now, so that debug is active during init! */
+ Debug = 1;
+ break;
+ case 'e': /* log every message (no repeat message supression) */
+ fprintf(stderr, "note: -e option is no longer supported, every message is now logged by default\n");
+ bEOptionWasGiven = 1;
+ break;
+ case 'g': /* enable tcp gssapi logging */
+#if defined(SYSLOG_INET) && defined(USE_GSSAPI)
+ CHKiRet(bufOptAdd('g', optarg));
+#else
+ fprintf(stderr, "rsyslogd: -g not valid - not compiled with gssapi support");
+#endif
+ break;
+ case 'M': /* default module load path -- this MUST be carried out immediately! */
+ glblModPath = (uchar*) optarg;
+ break;
+ case 'r': /* accept remote messages */
+#ifdef SYSLOG_INET
+ CHKiRet(bufOptAdd(ch, optarg));
+#else
+ fprintf(stderr, "rsyslogd: -r not valid - not compiled with network support\n");
+#endif
+ break;
+ case 't': /* enable tcp logging */
+#ifdef SYSLOG_INET
+ CHKiRet(bufOptAdd(ch, optarg));
+#else
+ fprintf(stderr, "rsyslogd: -t not valid - not compiled with network support\n");
+#endif
+ break;
+ case 'v': /* MUST be carried out immediately! */
+ printVersion();
+ exit(0); /* exit for -v option - so this is a "good one" */
+ case '?':
+ default:
+ usage();
+ }
+ }
+
+ if ((argc -= optind))
+ usage();
+
+ dbgprintf("rsyslogd %s startup, compatibility mode %d, module path '%s'\n",
+ VERSION, iCompatibilityMode, glblModPath == NULL ? "" : (char*)glblModPath);
+
+ /* we are done with the initial option parsing and processing. Now we init the system. */
+
+ ppid = getpid();
+
+ CHKiRet_Hdlr(InitGlobalClasses()) {
+ fprintf(stderr, "rsyslogd initializiation failed - global classes could not be initialized.\n"
+ "Did you do a \"make install\"?\n"
+ "Suggested action: run rsyslogd with -d -n options to see what exactly "
+ "fails.\n");
+ FINALIZE;
+ }
+
+ /* doing some core initializations */
+
+ /* get our host and domain names - we need to do this early as we may emit
+ * error log messages, which need the correct hostname. -- rgerhards, 2008-04-04
+ */
+ net.getLocalHostname(&LocalHostName);
+ if((p = (uchar*)strchr((char*)LocalHostName, '.'))) {
+ *p++ = '\0';
+ LocalDomain = p;
+ } else {
+ LocalDomain = (uchar*)"";
+
+ /* It's not clearly defined whether gethostname()
+ * should return the simple hostname or the fqdn. A
+ * good piece of software should be aware of both and
+ * we want to distribute good software. Joey
+ *
+ * Good software also always checks its return values...
+ * If syslogd starts up before DNS is up & /etc/hosts
+ * doesn't have LocalHostName listed, gethostbyname will
+ * return NULL.
+ */
+ /* TODO: gethostbyname() is not thread-safe, but replacing it is
+ * not urgent as we do not run on multiple threads here. rgerhards, 2007-09-25
+ */
+ hent = gethostbyname((char*)LocalHostName);
+ if(hent) {
+ free(LocalHostName);
+ CHKmalloc(LocalHostName = (uchar*)strdup(hent->h_name));
+
+ if((p = (uchar*)strchr((char*)LocalHostName, '.')))
+ {
+ *p++ = '\0';
+ LocalDomain = p;
+ }
+ }
+ }
+
+ /* Convert to lower case to recognize the correct domain laterly */
+ for(p = LocalDomain ; *p ; p++)
+ *p = (char)tolower((int)*p);
+
+ /* we now have our hostname and can set it inside the global vars.
+ * TODO: think if all of this would better be a runtime function
+ * rgerhards, 2008-04-17
+ */
+ glbl.SetLocalHostName(LocalHostName);
+ glbl.SetLocalDomain(LocalDomain);
+
+ /* initialize the objects */
+ if((iRet = modInitIminternal()) != RS_RET_OK) {
+ fprintf(stderr, "fatal error: could not initialize errbuf object (error code %d).\n",
+ iRet);
+ exit(1); /* "good" exit, leaving at init for fatal error */
+ }
+
+ if((iRet = loadBuildInModules()) != RS_RET_OK) {
+ fprintf(stderr, "fatal error: could not activate built-in modules. Error code %d.\n",
+ iRet);
+ exit(1); /* "good" exit, leaving at init for fatal error */
+ }
+
+ /* END core initializations - we now come back to carrying out command line options*/
+
+ while((iRet = bufOptRemove(&ch, &arg)) == RS_RET_OK) {
+ dbgprintf("deque option %c, optarg '%s'\n", ch, arg);
+ switch((char)ch) {
+ case '4':
+ glbl.SetDefPFFamily(PF_INET);
+ break;
+ case '6':
+ glbl.SetDefPFFamily(PF_INET6);
+ break;
+ case 'A':
+ send_to_all++;
+ break;
+ case 'a':
+ if(iCompatibilityMode < 3) {
+ if(!bImUxSockLoaded) {
+ legacyOptsEnq((uchar *) "ModLoad imuxsock");
+ bImUxSockLoaded = 1;
+ }
+ snprintf((char *) legacyConfLine, sizeof(legacyConfLine), "addunixlistensocket %s", arg);
+ legacyOptsEnq(legacyConfLine);
+ } else {
+ fprintf(stderr, "error -a is no longer supported, use module imuxsock instead");
+ }
+ break;
+ case 'f': /* configuration file */
+ ConfFile = (uchar*) arg;
+ break;
+ case 'g': /* enable tcp gssapi logging */
+ if(iCompatibilityMode < 3) {
+ legacyOptsParseTCP(ch, arg);
+ } else
+ fprintf(stderr, "-g option only supported in compatibility modes 0 to 2 - ignored\n");
+ break;
+ case 'h':
+ if(iCompatibilityMode < 3) {
+ errmsg.LogError(0, NO_ERRCODE, "WARNING: -h option is no longer supported - ignored");
+ } else {
+ usage(); /* for v3 and above, it simply is an error */
+ }
+ break;
+ case 'i': /* pid file name */
+ PidFile = arg;
+ break;
+ case 'l':
+ if(glbl.GetLocalHosts() != NULL) {
+ fprintf (stderr, "rsyslogd: Only one -l argument allowed, the first one is taken.\n");
+ } else {
+ glbl.SetLocalHosts(crunch_list(arg));
+ }
+ break;
+ case 'm': /* mark interval */
+ if(iCompatibilityMode < 3) {
+ MarkInterval = atoi(arg) * 60;
+ } else
+ fprintf(stderr,
+ "-m option only supported in compatibility modes 0 to 2 - ignored\n");
+ break;
+ case 'n': /* don't fork */
+ NoFork = 1;
+ break;
+ case 'N': /* enable config verify mode */
+ iConfigVerify = atoi(arg);
+ break;
+ case 'o':
+ if(iCompatibilityMode < 3) {
+ if(!bImUxSockLoaded) {
+ legacyOptsEnq((uchar *) "ModLoad imuxsock");
+ bImUxSockLoaded = 1;
+ }
+ legacyOptsEnq((uchar *) "OmitLocalLogging");
+ } else {
+ fprintf(stderr, "error -o is no longer supported, use module imuxsock instead");
+ }
+ break;
+ case 'p':
+ if(iCompatibilityMode < 3) {
+ if(!bImUxSockLoaded) {
+ legacyOptsEnq((uchar *) "ModLoad imuxsock");
+ bImUxSockLoaded = 1;
+ }
+ snprintf((char *) legacyConfLine, sizeof(legacyConfLine), "SystemLogSocketName %s", arg);
+ legacyOptsEnq(legacyConfLine);
+ } else {
+ fprintf(stderr, "error -p is no longer supported, use module imuxsock instead");
+ }
+ case 'q': /* add hostname if DNS resolving has failed */
+ *net.pACLAddHostnameOnFail = 1;
+ break;
+ case 'Q': /* dont resolve hostnames in ACL to IPs */
+ *net.pACLDontResolve = 1;
+ break;
+ case 'r': /* accept remote messages */
+ if(iCompatibilityMode < 3) {
+ legacyOptsEnq((uchar *) "ModLoad imudp");
+ snprintf((char *) legacyConfLine, sizeof(legacyConfLine), "UDPServerRun %s", arg);
+ legacyOptsEnq(legacyConfLine);
+ } else
+ fprintf(stderr, "-r option only supported in compatibility modes 0 to 2 - ignored\n");
+ break;
+ case 's':
+ if(glbl.GetStripDomains() != NULL) {
+ fprintf (stderr, "rsyslogd: Only one -s argument allowed, the first one is taken.\n");
+ } else {
+ glbl.SetStripDomains(crunch_list(arg));
+ }
+ break;
+ case 't': /* enable tcp logging */
+ if(iCompatibilityMode < 3) {
+ legacyOptsParseTCP(ch, arg);
+ } else
+ fprintf(stderr, "-t option only supported in compatibility modes 0 to 2 - ignored\n");
+ break;
+ case 'u': /* misc user settings */
+ iHelperUOpt = atoi(arg);
+ if(iHelperUOpt & 0x01)
+ bParseHOSTNAMEandTAG = 0;
+ if(iHelperUOpt & 0x02)
+ bChDirRoot = 0;
+ break;
+ case 'w': /* disable disallowed host warnigs */
+ glbl.SetOption_DisallowWarning(0);
+ break;
+ case 'x': /* disable dns for remote messages */
+ glbl.SetDisableDNS(1);
+ break;
+ case '?':
+ default:
+ usage();
+ }
+ }
+
+ if(iRet != RS_RET_END_OF_LINKEDLIST)
+ FINALIZE;
+
+ if(iConfigVerify) {
+ fprintf(stderr, "rsyslogd: version %s, config validation run (level %d), master config %s\n",
+ VERSION, iConfigVerify, ConfFile);
+ }
+
+ if(bChDirRoot) {
+ if(chdir("/") != 0)
+ fprintf(stderr, "Can not do 'cd /' - still trying to run\n");
+ }
+
+
+ /* process compatibility mode settings */
+ if(iCompatibilityMode < 3) {
+ errmsg.LogError(0, NO_ERRCODE, "WARNING: rsyslogd is running in compatibility mode. Automatically "
+ "generated config directives may interfer with your rsyslog.conf settings. "
+ "We suggest upgrading your config and adding -c3 as the first "
+ "rsyslogd option.");
+ if(MarkInterval > 0) {
+ legacyOptsEnq((uchar *) "ModLoad immark");
+ snprintf((char *) legacyConfLine, sizeof(legacyConfLine), "MarkMessagePeriod %d", MarkInterval);
+ legacyOptsEnq(legacyConfLine);
+ }
+ if(!bImUxSockLoaded) {
+ legacyOptsEnq((uchar *) "ModLoad imuxsock");
+ }
+ }
+
+ if(bEOptionWasGiven && iCompatibilityMode < 3) {
+ errmsg.LogError(0, NO_ERRCODE, "WARNING: \"message repeated n times\" feature MUST be turned on in "
+ "rsyslog.conf - CURRENTLY EVERY MESSAGE WILL BE LOGGED. Visit "
+ "http://www.rsyslog.com/rptdmsgreduction to learn "
+ "more and cast your vote if you want us to keep this feature.");
+ }
+
+ if(!iConfigVerify)
+ CHKiRet(doGlblProcessInit());
+
+ CHKiRet(mainThread());
+
+ /* do any de-init's that need to be done AFTER this comment */
+
+ die(bFinished);
+
+ thrdExit();
+
+finalize_it:
+ if(iRet == RS_RET_VALIDATION_RUN) {
+ fprintf(stderr, "rsyslogd: End of config validation run. Bye.\n");
+ } else if(iRet != RS_RET_OK) {
+ fprintf(stderr, "rsyslogd run failed with error %d (see rsyslog.h "
+ "or try http://www.rsyslog.com/e/%d to learn what that number means)\n", iRet, iRet*-1);
+ }
+
+ ENDfunc
+ return 0;
+}
+
+
+/* This is the main entry point into rsyslogd. This must be a function in its own
+ * right in order to intialize the debug system in a portable way (otherwise we would
+ * need to have a statement before variable definitions.
+ * rgerhards, 20080-01-28
+ */
+int main(int argc, char **argv)
+{
+ dbgClassInit();
+ return realMain(argc, argv);
+}
+
+/* vim:set ai:
+ */